Wellington标准品的主要用途有哪些
Wellington 提供的化学标准品是使用明确的合成路线制备的,并使用一系列方法进行纯化。 所有产品都经过至少 98% 的化学纯度纯化,并且 13C 标记产品的同位素纯度要求 >99%。 我们所有化合物的结构均使用多种技术明确确认,包括酌情使用 NMR(400 或 600MHz)、具有 LRMS 和/或 HRMS 的 HRGC、UPLC-MS/MS 和SFC/UV/MS/MS
准确性/可追溯性
本目录中列出的所有解决方案均在我们的实验室中使用:
• 由外部 ISO/IEC 17025 认可实验室定期校准的微量天平
• 外部砝码可追溯到 ISO/IEC 17025 认可的实验室,以验证
微量天平校准
• A 级容差的容量玻璃器皿校准并可溯源至
ISO/IEC 17025 认可实验室
• 玻璃蒸馏或 HPLC 级溶剂
• 复制解决方案以确保准确性并确认同质性
在可能的情况下,将这些解决方案与标准参考材料或其他来源的认证标准进行比较。 除非本目录中另有说明,否则溶液浓度的扩展最大相对不确定度百分比为 ± 5%
威灵顿化学不断增加工作人员和合成实验室规模,一直致力于在研究开发参考标准品,目前已有威灵顿化学超过10000产品发布。 威灵顿化学还将继续开发更多的化合物参考标准品,不断致力于研究如何保护自然环境和和保护人类健康。
Wellington标准品的主要用途有哪些
(+)aHBCD | 138257-19-9 | (+)-α-1S,2S,5R,6S,9S,10R-Hexabromocyclododecane |
(+)gHBCD | 678970-17-7 | (+)-γ-1R,2R,5R,6S,9S,10R-Hexabromocyclododecane |
(-)aHBCD | 678970-15-5 | (-)-α-1R,2R,5S,6R,9R,10S-Hexabromocyclododecane |
(-)gHBCD | 169102-57-2 | (-)-γ-1S,2S,5S,6R,9R,10S-Hexabromocyclododecane |
1,3-DPMA | 70267-37-7 | 1,3-Dechlorane Plus Mono adduct |
1-B-36-CCZ | 100125-05-1 | 1-Bromo-3,6-dichloro-9H-carbazole |
10:2FTAcr | 17741-60-5 | 1H,1H,2H,2H-Perfluorododecyl acrylate (>95%) |
10:2FTOAc | 37858-05-2 | 1H,1H,2H,2H-Perfluorododecyl acetate |
10:2FTS | 108026-35-3 | Sodium 1H,1H,2H,2H-perfluorododecane sulfonate(10:2) |
11Cl-PF3OUdS | 83329-89-9 | Potassium 11-chloroeicosafluoro-3-oxaundecane-1-sulfonate |
12-B-78-CDF | N/A | 1,2-Dibromo-7,8-dichlorodibenzofuran |
13-B-278-CDF | N/A | 1,3-Dibromo-2,7,8-trichlorodibenzofuran |
16130CS05 | M/C | Extended Calibration/Low Level Solution ((CS1)/2) |
16130CSL | M/C | Extended Calibration/Low Level Solution |
16130CVS | M/C | Alternative Method 16130 Calibration Kit |
18-B-36-CCZ | 100131-03-1 | 1,8-Dibromo-3,6-dichloro-9H-carbazole |
1H-HxChlor | 2597-11-7 | 1-Hydroxychlordene |
2-B-1378-CDD | 131167-13-0 | 2-Bromo-1,3,7,8-tetrachlorodibenzo-p-dioxin (>95%) |
2-B-378-CDD | 109333-33-7 | 2-Bromo-3,7,8-trichlorodibenzo-p-dioxin (>95%) |
225TCDF | M/C | 2378-TCDF Specificity Mix for DB/BP/HP/Rtx/SPB -225 |
23-B-78-CDD | 50585-40-5 | 2,3-Dibromo-7,8-dichlorodibenzo-p-dioxin |
23-B-78-CDF | N/A | 2,3-Dibromo-7,8-dichlorodibenzofuran |
24DIPPDPP | 96107-55-0 | 2,4-Diisopropylphenyl diphenyl phosphate |
24P-DDD | 53-19-0 | 1,1-Dichloro-2-(2-chlorophenyl)-2-(4-chlorophenyl)ethane |
24P-DDE | 3424-82-6 | 1,1-Dichloro-2-(2-chlorophenyl)-2-(4-chlorophenyl)ethene |
24P-DDT | 789-02-6 | 1,1,1-Trichloro-2-(2-chlorophenyl)-2-(4-chlorophenyl)ethane |
24P-DMDT | 30667-99-3 | o,p’-Methoxychlor |
2IPPDPP | 64532-94-1 | 2-Isopropylphenyl diphenyl phosphate |
2PMBDE68 | N/A | 2′,3,4′,5-Tetrabromo-2-methoxydiphenyl ether |
2tBPDPP | N/A | 2-tert-Butylphenyl diphenyl phosphate |
3,6-OPFHpA | 151772-58-6 | Perfluoro-3,6-dioxaheptanoic acid (NFDHA) |
3-B-278-CDF | 131166-87-5 | 3-Bromo-2,7,8-trichlorodibenzofuran |
33PDM155 | N/A | 2,2′,4,4′,6,6′-Hexachloro-3,3′-dimethoxybiphenyl |
3H118 | 170946-11-9 | 2,3′,4,4′,5-Pentachloro-3-biphenylol |
3H138 | N/A | 2,2′,3′,4,4′,5-Hexachloro-3-biphenylol |
3H153 | 54284-55-8 | 2,2′,4,4′,5,5′-Hexachloro-3-biphenylol |
3H180 | 158076-69-8 | 2,2′,3′,4,4′,5,5′-Heptachloro-3-biphenylol |
3IPPDPP | 69515-46-4 | 3-Isopropylphenyl diphenyl phosphate |
3M118 | N/A | 2,3′,4,4′,5-Pentachloro-3-methoxybiphenyl |
3PM138 | N/A | 2,2′,3′,4,4′,5-Hexachloro-3-methoxybiphenyl |
3PM180 | N/A | 2,2′,3,4,4′,5,5′-Heptachloro-3′-methoxybiphenyl |
3PM182 | N/A | 2,2′,3,4,4′,5,6′-Heptachloro-3′-methoxybiphenyl |
3PM183 | N/A | 2,2′,3′,4,4′,5,6′-Heptachloro-3-methoxybiphenyl |
3PM184 | N/A | 2,2′,3,4,4′,6,6′-Heptachloro-3′-methoxybiphenyl |
3PM203 | N/A | 2,2′,3,4,4′,5,5′,6-Octachloro-3′-methoxybiphenyl |
3tBPDPP | N/A | 3-tert-Butylphenyl diphenyl phosphate |
4-B-2378-CDF | 115656-08-1 | 4-Bromo-2,3,7,8-tetrachlorodibenzofuran |
44P-DDD | 72-54-8 | 1,1-Dichloro-2,2-bis(4-chlorophenyl)ethane |
44P-DDE | 72-55-9 | 1,1-Dichloro-2,2-bis(4-chlorophenyl)ethene |
44P-DDT | 50-29-3 | 1,1,1-Trichloro-2,2-bis(4-chlorophenyl)ethane |
44P-DMDT | 72-43-5 | p,p’-Methoxychlor |
44PDM202 | N/A | 2,2′,3,3′,5,5′,6,6′-Octachloro-4,4′-dimethoxybiphenyl |
46MeTCS | N/A | 2,3,4-Trichloro-6-(2,4-dichlorophenoxy)anisole(4,6-Dichloro-methoxytriclosan) |
46TCS | 53555-01-4 | 2,3,4-Trichloro-6-(2,4-dichlorophenoxy)phenol(4,6-Dichlorotriclosan) |
48B-CVS | M/C | HRGC/HRMS Calibration Solutions (PCDDs/PCDFs) |
4:2FTS | 27619-93-8 | Sodium 1H,1H,2H,2H-perfluorohexane sulfonate(4:2) |
4H107 | 152969-11-4 | 2,3,3′,4′,5-Pentachloro-4-biphenylol |
4H108 | 149589-55-9 | 2′,3,3′,4′,5-Pentachloro-4-biphenylol (>96%) |
4H130 | 158076-62-1 | 2,2′,3,3′,4′,5-Hexachloro-4-biphenylol |
4H146 | 145413-90-7 | 2,2′,3,4′,5,5′-Hexachloro-4-biphenylol |
4H172 | 158076-64-3 | 2,2′,3,3′,4′,5,5′-Heptachloro-4-biphenylol |
4H187 | 158076-68-7 | 2,2′,3,4′,5,5′,6-Heptachloro-4-biphenylol |
4IPPDPP | 55864-04-5 | 4-Isopropylphenyl diphenyl phosphate |
4M107 | N/A | 2,3,3′,4′,5-Pentachloro-4-methoxybiphenyl |
4M134 | N/A | 2,2′,3,3′,5,6-Hexachloro-4-methoxybiphenyl |
4M146 | N/A | 2,2′,3,4′,5,5′-Hexachloro-4-methoxybiphenyl |
4M162 | N/A | 2,3,3′,4′,5,5′-Hexachloro-4-methoxybiphenyl |
4M163 | N/A | 2,3,3′,4′,5,6-Hexachloro-4-methoxybiphenyl |
4M177 | N/A | 2,2′,3,3′,4′,5,6-Heptachloro-4-methoxybiphenyl |
4M178 | N/A | 2,2′,3,3′,5,5′,6-Heptachloro-4-methoxybiphenyl |
4M187 | N/A | 2,2′,3,4′,5,5′,6-Heptachloro-4-methoxybiphenyl |
4M193 | N/A | 2,3,3′,4′,5,5′,6-Heptachloro-4-methoxybiphenyl |
4M202 | N/A | 2,2′,3,3′,5,5′,6,6′-Octachloro-4-methoxybiphenyl |
4MeTCS | N/A | 4,5-Dichloro-2-(2,4-dichlorophenoxy)anisole(4-Chloro-methoxytriclosan) |
4PC-BDE-208 | N/A | 2,2′,3,3′,4,5,5′,6,6′-Nonabromo-4′-chlorodiphenyl ether |
4PM101 | N/A | 2,2′,4,5,5′-Pentachloro-4′-methoxybiphenyl |
4PM108 | N/A | 2,3,3′,4,5′-Pentachloro-4′-methoxybiphenyl |
4PM120 | N/A | 2,3′,4,5,5′-Pentachloro-4′-methoxybiphenyl |
4PM127 | N/A | 3,3′,4,5,5′-Pentachloro-4′-methoxybiphenyl |
4PM130 | N/A | 2,2′,3,3′,4′,5-Hexachloro-4-methoxybiphenyl |
4PM159 | N/A | 2,3,3′,4,5,5′-Hexachloro-4′-methoxybiphenyl |
4PM172 | N/A | 2,2′,3,3′,4,5,5′-Heptachloro-4′-methoxybiphenyl |
4PM198 | N/A | 2,2′,3,3′,4,5,5′,6-Octachloro-4′-methoxybiphenyl |
4PM199 | N/A | 2,2′,3,3′,4′,5,5′,6-Octachloro-4-methoxybiphenyl |
4PM200 | N/A | 2,2′,3,3′,4,5,6,6′-Octachloro-4′-methoxybiphenyl |
4PM201 | N/A | 2,2′,3,3′,4′,5,6,6′-Octachloro-4-methoxybiphenyl |
4PM208 | N/A | 2,2′,3,3′,4,5,5′,6,6′-Nonachloro-4′-methoxybiphenyl |
4PM79 | N/A | 3,3′,4′,5-Tetrachloro-4-methoxybiphenyl |
4PM97 | N/A | 2,2′,3,4′,5′-Pentachloro-4-methoxybiphenyl |
4PMBDE101 | N/A | 2,2′,4,5,5′-Pentabromo-4′-methoxydiphenyl ether |
4PMBDE103 | N/A | 2,2′,4′,5,6′-Pentabromo-4-methoxydiphenyl ether |
4PMBDE49 | N/A | 2,2′,4′,5-Tetrabromo-4-methoxydiphenyl ether |
4tBPDPP | 981-40-8 | 4-tert-Butylphenyl diphenyl phosphate |
4TCS | 3380-44-7 | 4,5-Dichloro-2-(2,4-dichlorophenoxy)phenol(4-Chlorotriclosan) |
513-CS0.25 | M/C | Custom Calibration Solution |
513-CS4-1/10 | M/C | Custom Calibration Solution |
513-CS4RT | M/C | Custom Calibration Solution |
513-P-CS4 | M/C | 513-P-CS4 |
5:1:2FTB | 171184-02-4 | 2-[(3,4,4,5,5,6,6,7,7,8,8,8-Dodecafluorooctyl)dimethylammonio]acetate |
5:2sFTOH | 914637-05-1 | 1-Perfluoropentyl ethanol(5:2 secondary) |
5:3FTB | 171184-14-8 | 2-[(4,4,5,5,6,6,7,7,8,8,8-Undecafluorooctyl)dimethylammonio]acetate |
5CWDS | M/C | Window Defining Mixture for DB5/BP5/HP2/Rtx-5/SPB-5 |
5MBDE47 | N/A | 2,2′,4,4′-Tetrabromo-5-methoxydiphenyl ether |
5PMBDE100 | N/A | 2,2′,4,4′,6′-Pentabromo-5-methoxydiphenyl ether |
5PMBDE99 | N/A | 2,2′,4,4′,5-Pentabromo-5′-methoxydiphenyl ether |
5TCDD | M/C | 2378-TCDD Specificity Mix for DB5/BP5/HP2/Rtx-5/SPB-5 |
5TDWD | M/C | Combined Window Defining/TCDD Resolution Mix |
6-M-1248-CDF | N/A | 1,2,4,8-Tetrachloro-6-methyldibenzofuran |
6-M-138-CDF | N/A | 1,3,8-Trichloro-6-methyldibenzofuran |
68C-CS | M/C | Labelled Cleanup Stock Solution |
68C-CVS | M/C | EPA Method 1668C Calibration Kit(5x200ul + 500ul CS3) |
68C-IS | M/C | Labelled Injection/Internal Standard Stock Solution |
68C-LCS | M/C | Labelled Toxics/LOC/Window Defining Stock Solution |
68C-PAR | M/C | Native Toxics/LOC Stock Solution |
6:2/8:2diPAP | N/A | Sodium (1H,1H,2H,2H-perfluorooctyl-1H,1H.2H,2H-perfluorodecyl) phosphate |
6:2diPAP | 407582-79-0 | Sodium bis(1H,1H,2H,2H-perfluorooctyl) phosphate |
6:2FTS | 27619-94-9 | Sodium 1H,1H,2H,2H-perfluorooctane sulfonate(6:2) |
6:2PAP | 150033-29-7 | Disodium 1H,1H,2H,2H-perfluorooctyl phosphate |
6:6PFPi | 70609-44-8 | Sodium bis(perfluorohexyl)phosphinate |
6:8PFPi | 2361298-14-6 | Sodium perfluorohexylperfluorooctylphosphinate |
6MBDE47 | N/A | 2,2′,4,4′-Tetrabromo-6-methoxydiphenyl ether |
6MeTCS | N/A | 2,3-Dichloro-6-(2,4-dichlorophenoxy)anisole(6-Chloro-methoxytriclosan) |
6TCS | 63709-57-9 | 2,3-Dichloro-6-(2,4-dichlorophenoxy)phenol(6-Chlorotriclosan) |
7-B-23-CDD | 97741-74-7 | 7-Bromo-2,3-dichlorodibenzo-p-dioxin (>97%) |
7-M-1234-CDD | N/A | 1,2,3,4-Tetrachloro-7-methyldibenzo-p-dioxin |
78-M-234-CDF | N/A | 2,3,4-Trichloro-7,8-dimethyldibenzofuran |
7:2sFTOH | 24015-83-6 | 1-Perfluoroheptyl ethanol(7:2 secondary) |
8-B-23-CDF | 103124-75-0 | 8-Bromo-2,3-dichlorodibenzofuran |
8-B-234-CDF | 103124-72-7 | 8-Bromo-2,3,4-trichlorodibenzofuran |
8-M-1247-CDF | N/A | 1,2,4,7-Tetrachloro-8-methyldibenzofuran |
8-M-23-CDF | N/A | 2,3-Dichloro-8-methyldibenzofuran |
8-M-237-CDD | N/A | 2,3,7-Trichloro-8-methyldibenzo-p-dioxin |
8:2diPAP | 114519-85-6 | Sodium bis(1H,1H,2H,2H-perfluorodecyl) phosphate |
8:2FTAcr | 27905-45-9 | 1H,1H,2H,2H-Perfluorodecyl acrylate |
8:2FTOAc | 37858-04-1 | 1H,1H,2H,2H-Perfluorodecyl acetate |
8:2FTS | 27619-96-1 | Sodium 1H,1H,2H,2H-perfluorodecane sulfonate(8:2) |
8:2PAP | 438237-75-3 | Disodium 1H,1H,2H,2H-perfluorodecyl phosphate |
8:8PFPi | 500776-69-2 | Sodium bis(perfluorooctyl)phosphinate |
8Cl-PFOS | 2481740-05-8 | Sodium 8-chloroperfluoro-1-octanesulfonate |
9Cl-PF3ONS | 73606-19-6 (F-53B) | Potassium 9-chlorohexadecafluoro-3-oxanonane-1-sulfonate |
a-DP | 135821-74-8 | anti-Dechlorane Plus |
abTBECH | 3322-93-8 | TBECH Isomeric Solution/Mixture |
aCl10DP | 1632364-26-1 | Cl10 Dechlorane Plus |
aCl11DP | 1258787-06-2 | Cl11 Dechlorane Plus |
aENDOS | 959-98-8 | Endosulfan I (alpha) |
aHBCD | 134237-50-6 | rac-alpha-1,2,5,6,9,10-Hexabromocyclododecane |
aHCH | 319-84-6 | alpha-1,2,3,4,5,6-Hexachlorocyclohexane |
ALD | 309-00-2 | Aldrin |
aTBCO | 3194-57-8 | (1R,2R,5S,6S)-1,2,5,6-Tetrabromocyclooctane |
ATE | 3278-89-5 | Allyl 2,4,6-tribromophenyl ether |
axCl11DP | 1826842-25-4 | exo-anti-Cl11-Dechlorane Plus |
axxCl10DP | 2305587-45-3 | exo-exo-anti-Cl10-Dechlorane Plus |
B24DIPPPP | 2190501-29-0 | Bis(2,4-diisopropylphenyl) phenyl phosphate |
B2IPPPP | 69500-29-4 | Bis(2-isopropylphenyl) phenyl phosphate |
B2tBPPP | 65652-41-7 | Bis(2-tert-butylphenyl) phenyl phosphate |
B3IPPPP | 69500-30-7 | Bis(3-isopropylphenyl) phenyl phosphate |
B3tBPPP | N/A | Bis(3-tert-butylphenyl) phenyl phosphate |
B4IPPPP | 55864-07-8 | Bis(4-isopropylphenyl) phenyl phosphate |
B4tBPPP | 115-87-7 | Bis(4-tert-butylphenyl) phenyl phosphate |
BATE | 99717-56-3 | 2-Bromoallyl 2,4,6-tribromophenyl ether |
BB-1 | 2052-07-5 | 2-Bromobiphenyl |
BB-10 | 59080-32-9 | 2,6-Dibromobiphenyl |
BB-101 | 67888-96-4 | 2,2′,4,5,5′-Pentabromobiphenyl |
BB-103 | 59080-39-6 | 2,2′,4,5′,6-Pentabromobiphenyl |
BB-15 | 92-86-4 | 4,4′-Dibromobiphenyl |
BB-153 | 59080-40-9 | 2,2′,4,4′,5,5′-Hexabromobiphenyl |
BB-154 | 36402-15-0 | 2,2′,4,4′,5,6′-Hexabromobiphenyl |
BB-155 | 59261-08-4 | 2,2′,4,4′,6,6′-Hexabromobiphenyl |
BB-156 | 77607-09-1 | 2,3,3′,4,4′,5-Hexabromobiphenyl |
BB-169 | 60044-26-0 | 3,3′,4,4′,5,5′-Hexabromobiphenyl |
BB-18 | 59080-34-1 | 2,2′,5-Tribromobiphenyl |
BB-180 | 67733-52-2 | 2,2′,3,4,4′,5,5′-Heptabromobiphenyl |
BB-194 | 67889-00-3 | 2,2′,3,3′,4,4′,5,5′-Octabromobiphenyl |
BB-2 | 2113-57-7 | 3-Bromobiphenyl |
BB-205 | N/A | 2,3,3′,4,4′,5,5′,6-Octabromobiphenyl |
BB-206 | 69278-62-2 | 2,2′,3,3′,4,4′,5,5′,6-Nonabromobiphenyl |
BB-209 | 13654-09-6 | Decabromobiphenyl |
BB-22 | N/A | 2,3,4′-Tribromobiphenyl |
BB-26 | 59080-35-2 | 2,3′,5-Tribromobiphenyl |
BB-29 | 115245-07-3 | 2,4,5-Tribromobiphenyl |
BB-3 | 92-66-0 | 4-Bromobiphenyl |
BB-30 | 59080-33-0 | 2,4,6-Tribromobiphenyl |
BB-31 | 59080-36-3 | 2,4′,5-Tribromobiphenyl |
BB-37 | 6683-35-8 | 3,4,4′-Tribromobiphenyl |
BB-38 | 115245-08-4 | 3,4,5-Tribromobiphenyl |
BB-4 | 13029-09-9 | 2,2′-Dibromobiphenyl |
BB-49 | 60044-24-8 | 2,2′,4,5′-Tetrabromobiphenyl |
BB-52 | 59080-37-4 | 2,2′,5,5′-Tetrabromobiphenyl |
BB-53 | 60044-25-9 | 2,2′,5,6′-Tetrabromobiphenyl |
BB-56 | N/A | 2,3,3′,4′-Tetrabromobiphenyl |
BB-7 | 53592-10-2 | 2,4-Dibromobiphenyl |
BB-75 | 64258-02-2 | 2,4,4′,6-Tetrabromobiphenyl |
BB-77 | 77102-82-0 | 3,3′,4,4′-Tetrabromobiphenyl |
BB-80 | 16400-50-3 | 3,3′,5,5′-Tetrabromobiphenyl |
BB-9 | 57422-77-2 | 2,5-Dibromobiphenyl |
BCZ-136 | 55119-10-3 | 1,3,6-Tribromo-9H-carbazole |
BCZ-1368 | 55119-09-0 | 1,3,6,8-Tetrabromo-9H-carbazole |
BCZ-27 | 136630-39-2 | 2,7-Dibromo-9H-carbazole |
BCZ-3 | 1592-95-6 | 3-Bromo-9H-carbazole |
BCZ-36 | 6825-20-3 | 3,6-Dibromo-9H-carbazole |
BDCP | 72236-72-7 | Bis(1,3-dichloro-2-propyl) phosphate |
BDD-1 | 105908-71-2 | 1-Bromodibenzo-p-dioxin |
BDD-1234 | 104549-41-9 | 1,2,3,4-Tetrabromodibenzo-p-dioxin |
BDD-1234678 | 110999-47-8 | 1,2,3,4,6,7,8-Heptabromodibenzo-p-dioxin |
BDD-12346789 | 2170-45-8 | Octabromodibenzo-p-dioxin |
BDD-12378 | 109333-34-8 | 1,2,3,7,8-Pentabromodibenzo-p-dioxin |
BDD-12478 | 109333-35-9 | 1,2,4,7,8-Pentabromodibenzo-p-dioxin |
BDD-1378 | 109333-31-5 | 1,3,7,8-Tetrabromodibenzo-p-dioxin |
BDD-237 | 51974-40-4 | 2,3,7-Tribromodibenzo-p-dioxin |
BDD-2378 | 50585-41-6 | 2,3,7,8-Tetrabromodibenzo-p-dioxin |
BDD-27/28 | 39073-07-9; | 2,7/2,8-Dibromodibenzo-p-dioxin mix |
BDE-1 | 7025-06-1 | 2-Bromodiphenyl ether |
BDE-10 | 51930-04-2 | 2,6-Dibromodiphenyl ether |
BDE-100 | 189084-64-8 | 2,2′,4,4′,6-Pentabromodiphenyl ether |
BDE-104 | 446254-68-8 | 2,2′,4,6,6′-Pentabromodiphenyl ether |
BDE-105 | 373594-78-6 | 2,3,3′,4,4′-Pentabromodiphenyl ether |
BDE-119 | 189084-66-0 | 2,3′,4,4′,6-Pentabromodiphenyl ether |
BDE-126 | 366791-32-4 | 3,3′,4,4′,5-Pentabromodiphenyl ether |
BDE-128 | N/A | 2,2′,3,3′,4,4′-Hexabromodiphenyl ether |
BDE-138 | 182677-30-1 | 2,2′,3,4,4′,5′-Hexabromodiphenyl ether |
BDE-139 | 446254-96-2 | 2,2′,3,4,4′,6-Hexabromodiphenyl ether |
BDE-140 | 243982-83-4 | 2,2′,3,4,4′,6′-Hexabromodiphenyl ether |
BDE-149 | N/A | 2,2′,3,4′,5′,6-Hexabromodiphenyl ether |
BDE-15 | 2050-47-7 | 4,4′-Dibromodiphenyl ether |
BDE-153 | 68631-49-2 | 2,2′,4,4′,5,5′-Hexabromodiphenyl ether |
BDE-154 | 207122-15-4 | 2,2′,4,4′,5,6′-Hexabromodiphenyl ether |
BDE-155 | 35854-94-5 | 2,2′,4,4′,6,6′-Hexabromodiphenyl ether |
BDE-156 | N/A | 2,3,3′,4,4′,5-Hexabromodiphenyl ether |
BDE-169 | N/A | 3,3′,4,4′,5,5′-Hexabromodiphenyl ether |
BDE-17 | 147217-75-2 | 2,2′,4-Tribromodiphenyl ether |
BDE-170 | 327185-13-7 | 2,2′,3,3′,4,4′,5-Heptabromodiphenyl ether |
BDE-171 | N/A | 2,2′,3,3′,4,4′,6-Heptabromodiphenyl ether |
BDE-175 | 446255-22-7 | 2,2′,3,3′,4,5′,6-Heptabromodiphenyl ether |
BDE-176 | N/A | 2,2′,3,3′,4,6,6′-Heptabromodiphenyl ether |
BDE-177 | N/A | 2,2′,3,3′,4′,5,6-Heptabromodiphenyl ether |
BDE-179 | N/A | 2,2′,3,3′,5,6,6′-Heptabromodiphenyl ether |
BDE-180 | N/A | 2,2′,3,4,4′,5,5′-Heptabromodiphenyl ether |
BDE-181 | 189084-67-1 | 2,2′,3,4,4′,5,6-Heptabromodiphenyl ether |
BDE-182 | N/A | 2,2′,3,4,4′,5,6′-Heptabromodiphenyl ether |
BDE-183 | 207122-16-5 | 2,2′,3,4,4′,5′,6-Heptabromodiphenyl ether |
BDE-184 | 117948-63-7 | 2,2′,3,4,4′,6,6′-Heptabromodiphenyl ether |
BDE-188 | N/A | 2,2′,3,4′,5,6,6′-Heptabromodiphenyl ether |
BDE-189 | N/A | 2,3,3′,4,4′,5,5′-Heptabromodiphenyl ether |
BDE-191 | 446255-30-7 | 2,3,3′,4,4′,5′,6-Heptabromodiphenyl ether |
BDE-194 | 85446-17-9 | 2,2′,3,3′,4,4′,5,5′-Octabromodiphenyl ether |
BDE-195 | 446255-38-5 | 2,2′,3,3′,4,4′,5,6-Octabromodiphenyl ether |
BDE-196 | N/A | 2,2′,3,3′,4,4′,5,6′-Octabromodiphenyl ether |
BDE-197 | 117964-21-3 | 2,2′,3,3′,4,4′,6,6′-Octabromodiphenyl ether |
BDE-198 | N/A | 2,2′,3,3′,4,5,5′,6-Octabromodiphenyl ether |
BDE-199 | N/A | 2,2′,3,3′,4,5,5′,6′-Octabromodiphenyl ether |
BDE-2 | 6876-00-2 | 3-Bromodiphenyl ether |
BDE-200 | N/A | 2,2′,3,3′,4,5,6,6′-Octabromodiphenyl ether |
BDE-201 | 446255-50-1 | 2,2′,3,3′,4,5′,6,6′-Octabromodiphenyl ether |
BDE-202 | 67797-09-5 | 2,2′,3,3′,5,5′,6,6′-Octabromodiphenyl ether |
BDE-203 | 337513-72-1 | 2,2′,3,4,4′,5,5′,6-Octabromodiphenyl ether |
BDE-204 | 446255-54-5 | 2,2′,3,4,4′,5,6,6′-Octabromodiphenyl ether |
BDE-205 | 446255-56-7 | 2,3,3′,4,4′,5,5′,6-Octabromodiphenyl ether |
BDE-206 | 63387-28-0 | 2,2′,3,3′,4,4′,5,5′,6-Nonabromodiphenyl ether |
BDE-207 | 437701-79-6 | 2,2′,3,3′,4,4′,5,6,6′-Nonabromodiphenyl ether |
BDE-208 | 437701-78-5 | 2,2′,3,3′,4,5,5′,6,6′-Nonabromodiphenyl ether |
BDE-209 | 1163-19-5 | Decabromodiphenyl ether |
BDE-21 | 337513-67-4 | 2,3,4-Tribromodiphenyl ether |
BDE-28 | 41318-75-6 | 2,4,4′-Tribromodiphenyl ether |
BDE-3 | 101-55-3 | 4-Bromodiphenyl ether |
BDE-30 | 155999-95-4 | 2,4,6-Tribromodiphenyl ether |
BDE-37 | 147217-81-0 | 3,4,4′-Tribromodiphenyl ether |
BDE-47 | 5436-43-1 | 2,2′,4,4′-Tetrabromodiphenyl ether |
BDE-49 | 243982-82-3 | 2,2′,4,5′-Tetrabromodiphenyl ether |
BDE-54 | N/A | 2,2′,6,6′-Tetrabromodiphenyl ether |
BDE-60 | 446254-31-5 | 2,3,4,4′-Tetrabromodiphenyl ether |
BDE-66 | 189084-61-5 | 2,3′,4,4′-Tetrabromodiphenyl ether |
BDE-7 | 171977-44-9 | 2,4-Dibromodiphenyl ether |
BDE-71 | 189084-62-6 | 2,3′,4′,6-Tetrabromodiphenyl ether |
BDE-77 | 93703-48-1 | 3,3′,4,4′-Tetrabromodiphenyl ether |
BDE-82 | N/A | 2,2′,3,3′,4-Pentabromodiphenyl ether |
BDE-85 | 182346-21-0 | 2,2′,3,4,4′-Pentabromodiphenyl ether |
BDE-99 | 60348-60-9 | 2,2′,4,4′,5-Pentabromodiphenyl ether |
BDE-CVS-E | M/C | BDE-CVS-E Calibration Kit |
BDE-CVS-EISS | N/A | Mass-Labelled PBDE Internal Standard Solution |
BDE-CVS-EISS-STK | N/A | Mass-Labelled PBDE Internal Standard Stock Solution |
BDE-CVS-F | M/C | BDE-CVS-F Calibration Kit |
BDE-CVS-G | M/C | BDE-CVS-G Calibration Kit |
BDE-MXA | M/C | Native PBDE Solution/Mixture |
BDE-MXB | M/C | Native PBDE Solution/Mixture |
BDE-MXD | M/C | Native PBDE Solution/Mixture |
BDE-MXE | M/C | Native PBDE Solution/Mixture |
BDE-MXF | M/C | Native PBDE Stock |
BDE-OND | M/C | Solution/Mixture of Octa-, Nona-, and Deca-BDEs |
BDE-WD | M/C | PBDE Window Defining Solution/Mixture for DB-5HT |
BDF-1234678 | 107555-95-3 | 1,2,3,4,6,7,8-Heptabromodibenzofuran |
BDF-12346789 | 103582-29-2 | Octabromodibenzofuran |
BDF-12378 | 107555-93-1 | 1,2,3,7,8-Pentabromodibenzofuran |
BDF-1278 | 84761-80-8 | 1,2,7,8-Tetrabromodibenzofuran |
BDF-138 | 142408-19-3 | 1,3,8-Tribromodibenzofuran |
BDF-234 | N/A | 2,3,4-Tribromodibenzofuran |
BDF-23478 | 131166-92-2 | 2,3,4,7,8-Pentabromodibenzofuran |
BDF-2378 | 67733-57-7 | 2,3,7,8-Tetrabromodibenzofuran |
BDF-238 | 84761-82-0 | 2,3,8-Tribromodibenzofuran |
BDF-24 | 133953-36-3 | 2,4-Dibromodibenzofuran |
BDF-247 | 617707-53-6 | 2,4,7-Tribromodibenzofuran |
BDF-28 | 10016-52-1 | 2,8-Dibromodibenzofuran |
BDF-4 | 89827-45-2 | 4-Bromodibenzofuran |
BEHTBP | 26040-51-7 | Bis(2-ethyl-1-hexyl)tetrabromophthalate |
bENDOS | 33213-65-9 | Endosulfan II (beta) |
BFR-CVS | M/C | PBDE/BFR Calibration Kit |
BFR-ISS | M/C | Internal/Injection Standards |
BFR-ISS-STK | M/C | Internal/Injection Standard Stock Solution |
BFR-LCS | M/C | Labelled Compound Solution |
BFR-LCS-STK | M/C | Labelled Compound Stock Solution |
BFR-PAR | M/C | Native Compounds StockSolution |
BFR-SCS | M/C | Sampling/Cleanup Standard |
bHBCD | 134237-51-7 | rac-beta-1,2,5,6,9,10-Hexabromocyclododecane |
bHCH | 319-85-7 | beta-1,2,3,4,5,6-Hexachlorocyclohexane |
BP-CP81 | M/C | Native Coplanar PCB Solution/Mixture |
BP-D7 | M/C | Native PCB Congener Solution/Mixture |
BP-MO | M/C | Solution/Mixture of Native Mono-ortho PCBs |
BP-MS | M/C | Native PCB Solution/Mixture for MS Detection |
BP-MS-PL1 | M/C | Native PCB Solution/Mixture for MS Detection |
BP-MS-PL2 | M/C | Native PCB Solution/Mixture for MS Detection |
BP-MS-PL3 | M/C | Native PCB Solution/Mixture for MS Detection |
BP-MS2 | M/C | Native PCB Solution/Mixture for MS Detection |
BP-MS3 | M/C | Native PCB Solution/Mixture for MS Detection |
BP-MX-C1 | M/C | Solution/Mixture of Native PCBs |
BP-MXP | M/C | Native PCB Mixture Solution |
BP-PG-MXA | M/C | Native PCB Mixture/Solution |
BP-WD | M/C | Native PCB Window Defining Solution/Mixture for DB-5 |
BPA | 80-05-7 | Bisphenol A |
BPAF | 1478-61-1 | Bisphenol AF |
BPAP | 1571-75-1 | Bisphenol AP |
BPB | 77-40-7 | Bisphenol B |
BPF | 620-92-8 | Bisphenol F |
BPP | 2167-51-3 | Bisphenol P |
BPS | 80-09-1 | Bisphenol S |
BPZ | 843-55-0 | Bisphenol Z |
br-FOSA | M/C | Perfluorooctanesulfonamide isomeric mixture |
br-NEtFOSA | M/C | N-Ethylperfluorooctanesulfonamide isomeric mixture |
br-NEtFOSAA | N/A | N-ethylperfluorooctanesulfonamidoacetic acid Isomeric Mixture |
br-NEtFOSE | M/C | 2-(N-Ethylperfluorooctanesulfonamido)ethanol isomeric mixture |
br-NMeFOSA | M/C | N-Methylperfluorooctanesulfonamide isomeric mixture |
br-NMeFOSAA | N/A | N-methylperfluorooctanesulfonamidoacetic acid Isomeric Mixture |
br-NMeFOSE | M/C | 2-(N-Methylperfluorooctanesulfonamido)ethanol isomeric mixture |
br-PFHxSK | M/C | L-PFHxS with branched isomers (Potassium Salt) |
br-PFNA | M/C | Perfluorononanoic acid isomeric mixture |
br-PFOA | M/C | Perfluorooctanoic acid isomeric mixture |
br-PFOSK | M/C | L-PFOSK with branched isomers |
bTBCO | 3194-57-8 | rac-(1R,2R,5R,6R)-1,2,5,6-Tetrabromocyclooctane |
bTBECH | 3322-93-8 | rac-(1R,2R)-1,2-dibromo-(4S)-4-((1S)-1,2-dibromoethyl)cyclohexane |
BTBPE | 37853-59-1 | 1,2-Bis(2,4,6-tribromophenoxy)ethane |
CARP-2 | N/A | Reference Fish Tissue (homogenate) for Organic Contaminant Analysis |
CBCZ-MXB | M/C | Native Halogenated Carbazoles Solution/Mixture |
CBP-2 | 50558-21-9 | 2-Chlorobiphenylene |
CBP-23 | 909024-10-8 | 2,3-Dichlorobiphenylene |
CBP-236 | 909024-09-5 | 2,3,6-Trichlorobiphenylene |
CBP-2367 | 7090-41-7 | 2,3,6,7-Tetrachlorobiphenylene |
CBS | M/C | Native Chlorobenzene Solution/Mixture |
cChlorD | 5103-71-9 | cis-Chlordane (alpha) |
CCZ-1368 | 58910-96-6 | 1,3,6,8-Tetrachloro-9H-carbazole |
CCZ-2367 | 697298-02-5 | 2,3,6,7-Tetrachloro-9H-carbazole |
CCZ-3 | 2732-25-4 | 3-Chloro-9H-carbazole |
CCZ-36 | 5599-71-3 | 3,6-Dichloro-9H-carbazole |
Cl-PFHxPA | N/A | 6-Chloroperfluorohexylphosphonic acid |
Cl-PFOPA | N/A | 8-Chloroperfluorooctylphosphonic acid |
cNChlor | 5103-73-1 | cis-Nonachlor |
CPlus | 13560-91-3 | Chlordene Plus |
CPS | M/C | Native Chlorophenol Solution/Mixture |
CS3WT | M/C | EPA-1613CS3 + Window Defining/2378-TCDD Resolution Mix |
CYA | 108-80-5 | Cyanuric Acid |
d-N-EtFOSA-M | 936109-40-9 | N-ethyl-d5-perfluoro-1-octanesulfonamide |
d-N-MeFOSA-M | 936109-37-4 | N-methyl-d3-perfluoro-1-octanesulfonamide |
d3-N-MeFOSAA | N/A | N-methyl-d3-perfluoro-1-octanesulfonamidoacetic acid |
d5-N-EtFOSAA | 1265205-97-7 | N-ethyl-d5-perfluoro-1-octanesulfonamidoacetic acid |
d7-N-MeFOSE-M | 1265205-95-5 | 2-(N-methyl-d3-perfluoro-1-octanesulfonamido)ethan-d4-ol |
d9-N-EtFOSE-M | 1265205-96-6 | 2-(N-ethyl-d5-perfluoro-1-octanesulfonamido)ethan-d4-ol |
DaHBCD | 870247-99-7 | d18-rac-alpha-1,2,5,6,9,10-Hexabromocyclododecane |
DBALD | 1482458-57-0 | Dibromoaldrin |
DBCD | 18300-04-4 | Dibromochlordene |
dBDCP | N/A | Bis(1,3-dichloro-2-propyl) phosphate-d10 |
DBDPE | 84852-53-9 | 1,2-Bis(pentabromophenyl)ethane |
DbHBCD | 870248-01-4 | d18-rac-beta-1,2,5,6,9,10-Hexabromocyclododecane |
DD-0-S | 262-12-4 | Dibenzo-p-dioxin |
DD-1-S | 39227-53-7 | 1-Chlorodibenzo-p-dioxin |
DD-123-S | 54536-17-3 | 1,2,3-Trichlorodibenzo-p-dioxin |
DD-1234-S | 30746-58-8 | 1,2,3,4-Tetrachlorodibenzo-p-dioxin |
DD-123467-S | 58200-66-1 | 1,2,3,4,6,7-Hexachlorodibenzo-p-dioxin |
DD-1234678-S | 35822-46-9 | 1,2,3,4,6,7,8-Heptachlorodibenzo-p-dioxin |
DD-12346789-S | 3268-87-9 | Octachlorodibenzo-p-dioxin |
DD-123468-S | 58200-67-2 | 1,2,3,4,6,8-Hexachlorodibenzo-p-dioxin |
DD-123478-S | 39227-28-6 | 1,2,3,4,7,8-Hexachlorodibenzo-p-dioxin |
DD-123678-S | 57653-85-7 | 1,2,3,6,7,8-Hexachlorodibenzo-p-dioxin |
DD-12378-S | 40321-76-4 | 1,2,3,7,8-Pentachlorodibenzo-p-dioxin |
DD-123789-S | 19408-74-3 | 1,2,3,7,8,9-Hexachlorodibenzo-p-dioxin |
DD-124-S | 39227-58-2 | 1,2,4-Trichlorodibenzo-p-dioxin |
DD-124679-S | 39227-62-8 | 1,2,4,6,7,9-Hexachlorodibenzo-p-dioxin |
DD-1247/1248-S | 71669-28-8; | 1,2,4,7/1,2,4,8-Tetrachlorodibenzo-p-dioxin mix |
DD-12478-S | 58802-08-7 | 1,2,4,7,8-Pentachlorodibenzo-p-dioxin |
DD-1278-S | 34816-53-0 | 1,2,7,8-Tetrachlorodibenzo-p-dioxin |
DD-1289-S | 62470-54-6 | 1,2,8,9-Tetrachlorodibenzo-p-dioxin |
DD-1368-S | 33423-92-6 | 1,3,6,8-Tetrachlorodibenzo-p-dioxin |
DD-1378-S | 50585-46-1 | 1,3,7,8-Tetrachlorodibenzo-p-dioxin |
DD-1379-S | 62470-53-5 | 1,3,7,9-Tetrachlorodibenzo-p-dioxin |
DD-1478-S | 40581-94-0 | 1,4,7,8-Tetrachlorodibenzo-p-dioxin |
DD-2-S | 39227-54-8 | 2-Chlorodibenzo-p-dioxin |
DD-23-S | 29446-15-9 | 2,3-Dichlorodibenzo-p-dioxin |
DD-237-S | 33857-28-2 | 2,3,7-Trichlorodibenzo-p-dioxin |
DD-2378-S | 1746-01-6 | 2,3,7,8-Tetrachlorodibenzo-p-dioxin |
DD-27-S | 33857-26-0 | 2,7-Dichlorodibenzo-p-dioxin |
DD-28-S | 38964-22-6 | 2,8-Dichlorodibenzo-p-dioxin |
DDF-MDT | M/C | Native PCDD/PCDF Solution/Mixture |
Dec-601 | 13560-90-2 | Dechlorane 601 |
Dec-602 | 31107-44-5 | Dechlorane 602 |
Dec-603 | 13560-92-4 | Dechlorane 603 |
Dec-604 | 34571-16-9 | Dechlorane 604 |
Dec-604CB | 56890-89-2 | Dechlorane 604 Component B |
DELD | 60-57-1 | Dieldrin |
DET-MXA | M/C | Native DDT & Related Compound Solution/Mixture |
DF-0-S | 132-64-9 | Dibenzofuran |
DF-123467-S | 79060-60-9 | 1,2,3,4,6,7-Hexachlorodibenzofuran |
DF-1234678-S | 67562-39-4 | 1,2,3,4,6,7,8-Heptachlorodibenzofuran |
DF-12346789-S | 39001-02-0 | Octachlorodibenzofuran |
DF-123468-S | 69698-60-8 | 1,2,3,4,6,8-Hexachlorodibenzofuran |
DF-1234689-S | 69698-58-4 | 1,2,3,4,6,8,9-Heptachlorodibenzofuran |
DF-12347-S | 83704-48-7 | 1,2,3,4,7-Pentachlorodibenzofuran |
DF-123478-S | 70648-26-9 | 1,2,3,4,7,8-Hexachlorodibenzofuran |
DF-1234789-S | 55673-89-7 | 1,2,3,4,7,8,9-Heptachlorodibenzofuran |
DF-12348-S | 67517-48-0 | 1,2,3,4,8-Pentachlorodibenzofuran |
DF-123489-S | 92341-07-6 | 1,2,3,4,8,9-Hexachlorodibenzofuran |
DF-1236-S | 83704-21-6 | 1,2,3,6-Tetrachlorodibenzofuran |
DF-12367-S | 57117-42-7 | 1,2,3,6,7-Pentachlorodibenzofuran |
DF-123678-S | 57117-44-9 | 1,2,3,6,7,8-Hexachlorodibenzofuran |
DF-12378-S | 57117-41-6 | 1,2,3,7,8-Pentachlorodibenzofuran |
DF-123789-S | 72918-21-9 | 1,2,3,7,8,9-Hexachlorodibenzofuran |
DF-12379-S | 83704-53-4 | 1,2,3,7,9-Pentachlorodibenzofuran |
DF-1238-S | 62615-08-1 | 1,2,3,8-Tetrachlorodibenzofuran |
DF-12389-S | 83704-54-5 | 1,2,3,8,9-Pentachlorodibenzofuran |
DF-1239-S | 83704-23-8 | 1,2,3,9-Tetrachlorodibenzofuran |
DF-1246-S | 71998-73-7 | 1,2,4,6-Tetrachlorodibenzofuran |
DF-12467-S | 83704-50-1 | 1,2,4,6,7-Pentachlorodibenzofuran |
DF-12468-S | 69698-57-3 | 1,2,4,6,8-Pentachlorodibenzofuran |
DF-1247-S | 83719-40-8 | 1,2,4,7-Tetrachlorodibenzofuran |
DF-12478-S | 58802-15-6 | 1,2,4,7,8-Pentachlorodibenzofuran |
DF-1248-S | 64126-87-0 | 1,2,4,8-Tetrachlorodibenzofuran |
DF-1267-S | 83704-25-0 | 1,2,6,7-Tetrachlorodibenzofuran |
DF-1278-S | 58802-20-3 | 1,2,7,8-Tetrachlorodibenzofuran |
DF-1279-S | 83704-26-1 | 1,2,7,9-Tetrachlorodibenzofuran |
DF-13467-S | 83704-36-3 | 1,3,4,6,7-Pentachlorodibenzofuran |
DF-1347-S | 70648-16-7 | 1,3,4,7-Tetrachlorodibenzofuran |
DF-13478-S | 58802-16-7 | 1,3,4,7,8-Pentachlorodibenzofuran |
DF-13479-S | 70648-20-3 | 1,3,4,7,9-Pentachlorodibenzofuran |
DF-1348-S | 92341-04-3 | 1,3,4,8-Tetrachlorodibenzofuran |
DF-1349-S | 83704-28-3 | 1,3,4,9-Tetrachlorodibenzofuran |
DF-136-S | 83704-39-6 | 1,3,6-Trichlorodibenzofuran |
DF-1367-S | 57117-36-9 | 1,3,6,7-Tetrachlorodibenzofuran |
DF-13678-S | 70648-21-4 | 1,3,6,7,8-Pentachlorodibenzofuran (>96%) |
DF-1368-S | 71998-72-6 | 1,3,6,8-Tetrachlorodibenzofuran |
DF-1369-S | 83690-98-6 | 1,3,6,9-Tetrachlorodibenzofuran |
DF-1378-S | 57117-35-8 | 1,3,7,8-Tetrachlorodibenzofuran |
DF-138-S | 76621-12-0 | 1,3,8-Trichlorodibenzofuran |
DF-146-S | 82911-60-2 | 1,4,6-Trichlorodibenzofuran |
DF-1467-S | 66794-59-0 | 1,4,6,7-Tetrachlorodibenzofuran |
DF-14678-S | 83704-35-2 | 1,4,6,7,8-Pentachlorodibenzofuran (or 2,3,4,6,9) |
DF-147-S | 83704-41-0 | 1,4,7-Trichlorodibenzofuran |
DF-1478-S | 83704-29-4 | 1,4,7,8-Tetrachlorodibenzofuran |
DF-149-S | 70648-13-4 | 1,4,9-Trichlorodibenzofuran |
DF-2-S | 51230-49-0 | 2-Chlorodibenzofuran |
DF-23-S | 64126-86-9 | 2,3-Dichlorodibenzofuran |
DF-234-S | 57117-34-7 | 2,3,4-Trichlorodibenzofuran |
DF-2346-S | 83704-30-7 | 2,3,4,6-Tetrachlorodibenzofuran |
DF-23467-S | 57117-43-8 | 2,3,4,6,7-Pentachlorodibenzofuran |
DF-234678-S | 60851-34-5 | 2,3,4,6,7,8-Hexachlorodibenzofuran |
DF-2347-S | 83704-31-8 | 2,3,4,7-Tetrachlorodibenzofuran |
DF-23478-S | 57117-31-4 | 2,3,4,7,8-Pentachlorodibenzofuran |
DF-2348-S | 83704-32-9 | 2,3,4,8-Tetrachlorodibenzofuran |
DF-236-S | 57117-33-6 | 2,3,6-Trichlorodibenzofuran |
DF-2368-S | 57117-37-0 | 2,3,6,8-Tetrachlorodibenzofuran |
DF-2378-S | 51207-31-9 | 2,3,7,8-Tetrachlorodibenzofuran |
DF-238-S | 57117-32-5 | 2,3,8-Trichlorodibenzofuran |
DF-24-S | 24478-74-8 | 2,4-Dichlorodibenzofuran |
DF-246-S | 58802-14-5 | 2,4,6-Trichlorodibenzofuran |
DF-2467-S | 57117-38-1 | 2,4,6,7-Tetrachlorodibenzofuran |
DF-2468-S | 58802-19-0 | 2,4,6,8-Tetrachlorodibenzofuran |
DF-247-S | 83704-42-1 | 2,4,7-Trichlorodibenzofuran |
DF-248-S | 54589-71-8 | 2,4,8-Trichlorodibenzofuran |
DF-26-S | 60390-27-4 | 2,6-Dichlorodibenzofuran |
DF-267-S | 83704-45-4 | 2,6,7-Trichlorodibenzofuran |
DF-27-S | 74992-98-6 | 2,7-Dichlorodibenzofuran |
DF-28-S | 5409-83-6 | 2,8-Dichlorodibenzofuran |
DF-3467-S | 57117-40-5 | 3,4,6,7-Tetrachlorodibenzofuran |
DF-4-S | 74992-96-4 | 4-Chlorodibenzofuran |
DF-C10-CS8 | M/C | High Level Calibration Solution |
DF-C10-CS8 | M/C | High Level Calibration Solution |
DF-CVS-A10 | M/C | PCDD/PCDF HRMS Calibration and Verification Solutions |
DF-CVS-A5 | M/C | PCDD/PCDF HRMS Calibration and Verification Solutions |
DF-CVS-B10 | M/C | PCDD/PCDF HRMS Calibration and Verification Solutions |
DF-CVS-C10 | M/C | PCDD/PCDF HRMS Calibration and Verification Solutions |
DF-CVS-C10 | M/C | CS1/CS2/CS3/CS4/CS5/CS6 |
DF-IS-A | M/C | Mass-Labelled PCDD Internal Standard Solution |
DF-IS-A200 | M/C | Mass-Labelled PCDD Internal Standard Solution |
DF-IS-A40 | M/C | Mass-Labelled PCDD Internal Standard Solution |
DF-IS-B | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
DF-IS-B200 | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
DF-IS-B40 | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
DF-IS-C | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
DF-IS-C200 | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
DF-IS-C40 | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
DF-IS-D | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
DF-IS-D200 | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
DF-IS-D40 | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
DF-IS-E | M/C | Mass-Labelled PCDF Internal Standard Solution |
DF-IS-E200 | M/C | Mass-Labelled PCDF Internal Standard Solution |
DF-IS-E40 | M/C | Mass-Labelled PCDF Internal Standard Solution |
DF-IS-F | M/C | Mass-Labelled PCDF Internal Standard Solution |
DF-IS-F200 | M/C | Mass-Labelled PCDF Internal Standard Solution |
DF-IS-F40 | M/C | Mass-Labelled PCDF Internal Standard Solution |
DF-IS-G | M/C | Mass-Labelled PCDF Internal Standard Solution |
DF-IS-G200 | M/C | Mass-Labelled PCDF Internal Standard Solution |
DF-IS-G40 | M/C | Mass-Labelled PCDF Internal Standard Solution |
DF-IS-H | M/C | Mass-Labelled PCDF Internal Standard Solution |
DF-IS-H200 | M/C | Mass-Labelled PCDF Internal Standard Solution |
DF-IS-H40 | M/C | Mass-Labelled PCDF Internal Standard Solution |
DF-IS-I | M/C | Mass-Labelled PCDF Internal Standard Solution |
DF-IS-I200 | M/C | Mass-Labelled PCDF Internal Standard Solution |
DF-IS-I40 | M/C | Mass-Labelled PCDF Internal Standard Solution |
DF-IS-J | M/C | Mass-Labelled PCDD Internal Standard Solution |
DF-IS-J | M/C | Mass-Labelled PCDDs Syringe Spike Solution |
DF-IS-J100 | M/C | Mass-Labelled PCDD Internal Standard Solution |
DF-IS-J100 | M/C | Mass-Labelled PCDDs Syringe Spike Solution |
DF-IS-J20 | M/C | Mass-Labelled PCDD Internal Standard Solution |
DF-IS-J20 | M/C | Mass-Labelled PCDDs Syringe Spike Solution |
DF-LCS-A | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
DF-LCS-A20 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
DF-LCS-A200 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
DF-LCS-A40 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
DF-LCS-B | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
DF-LCS-B | M/C | Mass-Labelled PCDDs/PCDFs Solution/Mixture |
DF-LCS-B100 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
DF-LCS-B100 | M/C | Mass-Labelled PCDDs/PCDFs Solution/Mixture |
DF-LCS-B20 | M/C | Mass-Labelled PCDDs/PCDFs Solution/Mixture |
DF-LCS-B200 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
DF-LCS-B40 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
DF-LCS-C | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
DF-LCS-C100 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
DF-LCS-C200 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
DF-LCS-C40 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
DF-LCS-DOW2010 | M/C | Mass-Labelled PCDD/PCDF Custom Solution/Mixture |
DF-SS-A | M/C | Mass-Labelled PCDD Sampling Spike Solution |
DF-SS-A | M/C | Mass-Labelled PCDD Sampling Spike Solution |
DF-SS-A100 | M/C | Mass-Labelled PCDD Sampling Spike Solution |
DF-SS-A100 | M/C | Mass-Labelled PCDD Sampling Spike Solution |
DF-SS-A20 | M/C | Mass-Labelled PCDD Sampling Spike Solution |
DF-SS-A20 | M/C | Mass-Labelled PCDD Sampling Spike Solution |
DF-ST-A | M/C | Native PCDD/PCDF Solution/Mixture |
DF-ST-B | M/C | Native PCDD/PCDF Solution/Mixture |
DF-ST-C | M/C | Native PCDD/PCDF Solution/Mixture |
DF-ST-C | M/C | Native PCDD/PCDF Solution/Mixture |
DF-ST-C10 | M/C | Native PCDDs/PCDFs Solution/Mixture |
DFP-CVS-B1 | M/C | Calibration Solutions for PCDD/PCDF/PCBs |
DFP-CVS-B10 | M/C | PCDD/PCDF/PCB Calibration Kit |
DFP-CVS-B10 | M/C | CS1/CS2/CS3/CS4/CS5/CS6 |
DFP-IS-A | M/C | Mass-Labelled PCDF/PCB Syringe Spike |
DFP-IS-B10 | M/C | Mass-Labelled PCDD & PCB Internal Standard Solution |
DFP-IS-B10 | M/C | Mass-Labelled PCDD and PCB Syringe Spike Solution |
DFP-LCS-A | M/C | Mass-Labelled PCDD/PCDF/PCB Solution/Mixture |
DFP-LCS-B | M/C | Mass-Labelled PCDDs/PCDFs/PCBs Solution/Mixture |
DFP-LCS-B | M/C | Mass-Labelled PCDDs/PCDFs/DL-PCBs Solution/Mixture |
DFP-LCS-B100 | M/C | Mass-Labelled PCDDs/PCDFs/PCBs Solution/Mixture |
DFP-LCS-B100 | M/C | Mass-Labelled PCDDs/PCDFs/DL-PCBs Solution/Mixture |
DFP-LCS-B20 | M/C | Mass-Labelled PCDDs/PCDFs/PCBs Solution/Mixture |
DFP-LCS-B20 | M/C | Mass-Labelled PCDDs/PCDFs/DL-PCBs Solution/Mixture |
DFP-SS-A | M/C | Mass-Labelled PCDD/PCB Sampling Spike |
DFP-SS-A10 | M/C | Mass-Labelled PCDD & PCB Sampling Spike Solution |
DFP-SS-A10 | M/C | Mass-Labelled PCDD and PCB Sampling Spike Solution |
DFP-ST-C10 | M/C | Native PCDDs/PCDFs/DL-PCBs Solution/Mixture |
DgHBCD | 676552-83-3 | d18-rac-gamma-1,2,5,6,9,10-Hexabromocyclododecane |
dHBCD | 65701-47-5 | delta-1,2,5,6,9,10-Hexabromocyclododecane |
dHCH | 319-86-8 | delta-1,2,3,4,5,6-Hexachlorocyclohexane |
diSAmPAP | 23282-60-2 | Sodium bis-[2-(N-ethylperfluorooctane-1-sulfonamido)ethyl] phosphate |
DPE-0 | 101-84-8 | Diphenyl ether |
DPE-15 | 2444-89-5 | 4,4′-Dichlorodiphenyl ether |
DPE-209 | 31710-30-2 | Decachlorodiphenyl ether |
DPE-28 | 59039-21-3 | 2,4,4′-Trichlorodiphenyl ether |
DPE-3 | 7005-72-3 | 4-Chlorodiphenyl ether |
DPE-74 | 61328-45-8 | 2,4,4′,5-Tetrachlorodiphenyl ether |
DPE-77 | 56348-72-2 | 3,3′,4,4′-Tetrachlorodiphenyl ether |
DPE-99 | 60123-64-0 | 2,2′,4,4′,5-Pentachlorodiphenyl ether |
DPMA(1,5-DPMA) | 10297-21-9 | Dechlorane Plus Mono adduct |
DPTE | 35109-60-5 | 2,3-Dibromopropyl 2,4,6-tribromophenyl ether |
DS-1000 | M/C | Mass-Labelled PCDD Solution/Mixture |
dTBP | 61196-26-7 | Tri-n-butyl phophate-d27 |
dTCEP | 1276500-47-0 | Tris(2-chloroethyl) phosphate-d12 |
dTDCPP | 1447569-77-8 | Tris(1,3-dichloro-2-propyl) phophate-d15 |
dTEP | 135942-11-9 | Tri-ethyl phosphate-d15 |
dTPP | 1173020-30-8 | Triphenyl phosphate-d15 |
dTPrP | 1219794-92-9 | Tri-n-propyl phosphate-d21 |
EC-PCB-STOCK | M/C | Native PCB Solution/Mixture |
EC9605-CVS | M/C | PCB Calibration Solutions for GC/MS Calibration Kit |
EC9605-PAR | M/C | Precision and Recovery Solution |
EC9605-RS | M/C | Recovery Standard Solution |
EC9605-SS | M/C | Surrogate Solution |
eHBCD | 4736-49-6 | epsilon-1,2,5,6,9,10-Hexabromocyclododecane |
EHDP | 1241-94-7 | 2-Ethylhexyl diphenyl phosphate |
EHTBB | 183658-27-7 | 2-Ethylhexyl-2,3,4,5-tetrabromobenzoate |
EN-1948CSL | M/C | Extended Calibration/Low Level Solution |
EN-1948CVS | M/C | European Method EN-1948 Calibration Kit |
EN-1948ES | M/C | Extraction Standard Solution |
EN-1948IS | M/C | Syringe Standard Solution |
EN-1948SS | M/C | Sampling Standard Solution |
EN-1948STK | M/C | PCDD/PCDF Solution/Mixture |
END | 72-20-8 | Endrin |
END-Ald | 7421-93-4 | Endrin Aldehyde |
END-Ket | 53494-70-5 | Endrin Ketone |
ENDOS-S | 1031-07-8 | Endosulfan Sulfate |
EPA-1613CS0.5 | M/C | Extended Calibration/Low Level Solution ((CS1)/2) |
EPA-1613CSL | M/C | Extended Calibration/Low Level Solution |
EPA-1613CSS | N/A | Cleanup Standard Spiking Solution |
EPA-1613CSS-STK | M/C | Cleanup Standard Stock Solution |
EPA-1613CVS | M/C | EPA Method 1613 Calibration Kit |
EPA-1613ISS | M/C | Internal Standard Spiking Solution |
EPA-1613ISS-STK | M/C | Internal Standard Spiking Stock Solution |
EPA-1613LCS | M/C | Labelled Compound Stock Solution |
EPA-1613PAR | M/C | Precision and Recovery Stock Solution |
EPA-1613STOCK | M/C | EPA Method 1613 Native Stock Solution |
EPA-1633STK | M/C | EPA Method 1633 Native PFAS Stock Solution/Mixture |
EPA-1668CS | M/C | Cleanup Standard Solution |
EPA-1668CVS | M/C | EPA Method 1668 Calibration Kit |
EPA-1668IS | M/C | Internal Standard Stock Solution |
EPA-1668LCS | M/C | Labelled Compound Stock Solution |
EPA-1668PAR | M/C | Precision and Recovery Solution |
EPA-23AS | M/C | Alternative Standard |
EPA-23CS1-5 | M/C | EPA Method 23 Calibration Kit |
EPA-23IS | M/C | Internal Standard Solution |
EPA-23ISS | M/C | Internal Standard Stock Solution |
EPA-23RS | M/C | Recovery Standard Solution |
EPA-23SS | M/C | Surrogate Standard Solution |
EPA-23SSS | M/C | Surrogate Standard Stock Solution |
EPA-513CSSA | M/C | Cleanup Standard Spiking Solution |
EPA-513CSSB | M/C | Alternative Cleanup Standard Spiking Solution |
EPA-513CVS | M/C | EPA Method 513 Calibration Kit |
EPA-513ISS | M/C | Internal Standard Spiking Solution |
EPA-513LCSS | M/C | Labelled TCDD/TCDF Spiking Solution |
EPA-513PAR | M/C | Precision and Recovery Solution |
EPA-533APDS | M/C | EPA Method 533 Native Analyte Primary Dilution Standard (expanded br/linear mixture) |
EPA-533ES | M/C | U.S. EPA Method 533 Isotope Dilution Standard PDS |
EPA-533IS | M/C | U.S. EPA Method 533 Isotope Performance Standard PDS |
EPA-533PAR | M/C | U.S. EPA Method 533 Native Analyte Primary Dilution Standard (PDS) |
EPA-537APDS | M/C | EPA Method 537.1 Native Analyte Primary Dilution Standard (expanded br/linear mixture) |
EPA-537IS | M/C | U.S. EPA Method 537 Internal Standard Primary Dilution Standard (IS PDS) |
EPA-537PDS-R1 | M/C | U.S. EPA Method 537 Native Primary Dilution Standard |
EPA-537PDSL-R1 | M/C | U.S. EPA Method 537 Native Linear Primary Dilution Standard |
EPA-537SS-R1 | M/C | U.S. EPA Method 537 Surrogate Primary Dilution Standard (SUR PDS) |
EPA-8280CS | M/C | Cleanup Standard Solution |
EPA-8280CVS | M/C | EPA Method 8280 Calibration Kit |
EPA-8280IS | M/C | Internal Standard Solution |
EPA-8280ISB | M/C | Additional Internal Standard Solution |
EPA-8280MSS | M/C | Matrix Spiking Solution |
EPA-8280RS | M/C | Recovery Standard Solution |
EPA-8290HRCC0.25 | M/C | Supplemental Calibration Solution |
EPA-8290HRCC0.5 | M/C | Supplemental Calibration Solution |
EPA-8290HRCC1-5 | M/C | EPA Method 8290 Calibration Kit |
EPA-8290MSS | M/C | Matrix Spiking Solution |
EPA-8290RSS | M/C | Recovery Standard Solution |
EPA-8290SFS | M/C | Sample Fortification Solution |
EPA-8290STN | M/C | Native Stock PCDDs and PCDFs |
EPA-8327STK | M/C | EPA Method 8327 Native PFAS Precision and Recovery Standard Stock |
EPA-EU-PAH-ISS | M/C | Deuterated PAH Solution/Mixture |
EPA-PAH-LCS | M/C | Deuterated PAH Solution/Mixture |
EPA-PAH-STK | M/C | Native PAH Solution/Mixture |
etaHBCD | 1392102-29-2 | rac-eta-1,2,5,6,9,10-Hexabromocyclododecane |
EU-5813-NSS | M/C | 5813/20 Native PFAS Solution/Mixture |
EU-PAH-LCS | M/C | Deuterated PAH Solution/Mixture |
EU-PAH-STK | M/C | Native PAH Solution/Mixture |
FBET | 2043-47-2 | 2-Perfluorobutyl ethanol(4:2) |
FBSA-I | 30334-69-1 | Perfluoro-1-butanesulfonamide |
FDEA | 53826-13-4 | 2-Perfluorodecyl ethanoic acid(10:2) |
FDET | 865-86-1 | 2-Perfluorodecyl ethanol(10:2) |
FDSA-I | 4262-70-8 | Perfluoro-1-decanesulfonamide |
FDUEA | 70887-94-4 | 2H-Perfluoro-2-dodecenoic acid(10:2) |
FHEA | 53826-12-3 | 2-Perfluorohexyl ethanoic acid(6:2) |
FHET | 647-42-7 | 2-Perfluorohexyl ethanol(6:2) |
FHpPA | 812-70-4 | 3-Perfluoroheptyl propanoic acid(7:3) |
FHpSA-I | 82765-77-3 | Perfluoro-1-heptanesulfonamide |
FHUEA | 70887-88-6 | 2H-Perfluoro-2-octenoic acid(6:2) |
FHxSA-I | 41997-13-1 | Perfluoro-1-hexanesulfonamide |
FOEA | 27854-31-5 | 2-Perfluorooctyl ethanoic acid(8:2) |
FOET | 678-39-7 | 2-Perfluorooctyl ethanol(8:2) |
FOSA-I | 754-91-6 | Perfluoro-1-octanesulfonamide |
FOSAA | 2806-24-8 | Perfluoro-1-octanesulfonamidoacetic acid |
FOUEA | 70887-84-2 | 2H-Perfluoro-2-decenoic acid(8:2) |
FPePA | 914637-49-3 | 3-Perfluoropentyl propanoic acid(5:3) |
FPeSA-I | 82765-76-2 | Perfluoro-1-pentanesulfonamide |
FPrPA | 356-02-5 | 3-Perfluoropropyl propanoic acid(3:3) |
FS-1000 | M/C | Mass-Labelled PCDF Solution/Mixture |
FTA-MXA | M/C | Native FTA Solution/Mixture |
gdTBECH | 3322-93-8 | TBECH Isomeric Solution/Mixture |
gHBCD | 134237-52-8 | rac-gamma-1,2,5,6,9,10-Hexabromocyclododecane |
gHCH | 58-89-9 | gamma-1,2,3,4,5,6-Hexachlorocyclohexane |
gTBECH | 3322-93-8 | rac-(1R,2R)-1,2-dibromo-(4R)-4-((1R)-1,2-dibromoethyl)cyclohexane |
HBBZ | 87-82-1 | Hexabromobenzene |
HBCD-MXA | M/C | Native HBCD Mixture |
HCDBCO | 51936-55-1 | Hexachlorocyclopentenyl-dibromocyclooctane |
HCH-MXA | M/C | Native HCH Solution/Mixture |
HCPN | N/A | Hexachloro(phenyl)norbornene |
HFPO-DA | 13252-13-6 | 2,3,3,3-Tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoic acid (GenX) |
HpChlor | 76-44-8 | Heptachlor |
HpChlor-nEp | 28044-83-9 | Heptachlor-endo-epoxide (isomer A) |
HpChlor-xEp | 1024-57-3 | Heptachlor-exo-epoxide (isomer B) |
HxCB | 118-74-1 | Hexachlorobenzene |
HxChlor | 3734-48-3 | Chlordene |
iHBCD | 1392102-30-5 | rac-iota-1,2,5,6,9,10-Hexabromocyclododecane |
ipPFNA | 15899-31-7 | Perfluoro-7-methyloctanoic acid |
ipPFNS | 1383788-15-5 | Sodium perfluoro-7-methyloctanesulfonate |
ISO 21675-LSS | M/C | ISO 21675:2019 Labelled Stock Solution |
ISO 21675-NSS | M/C | ISO 21675:2019 Native Stock Solution |
ISOD | 465-73-6 | Isodrin |
KEP | 143-50-0 | Kepone |
kHBCD | 1392102-31-6 | rac-kappa-1,2,5,6,9,10-Hexabromocyclododecane |
L-PFBS | 29420-49-3 | Potassium perfluoro-1-butanesulfonate |
L-PFDoS | N/A | Sodium perfluoro-1-dodecanesulfonate |
L-PFDS | 2806-15-7 | Sodium perfluoro-1-decanesulfonate |
L-PFHpS | 21934-50-9 | Sodium perfluoro-1-heptanesulfonate |
L-PFHxS | 82382-12-5 | Sodium perfluoro-1-hexanesulfonate |
L-PFNS | 98789-57-2 | Sodium perfluoro-1-nonanesulfonate |
L-PFOS | 4021-47-0 | Sodium perfluoro-1-octanesulfonate |
L-PFOSK | 2795-39-3 | Potassium perfluoro-1-octanesulfonate |
L-PFPeS | N/A | Sodium perfluoro-1-pentanesulfonate |
L-PFPrS | 359868-82-9 | Sodium perfluoro-1-propanesulfonate |
L-PFTrDS | 174675-49-1 | Sodium perfluoro-1-tridecanesulfonate |
L-PFUdS | 441296-91-9 (anion) | Sodium perfluoro-1-undecanesulfonate |
L429-AS | M/C | Method 429 Alternate Standard Stock Solution |
L429-CVS | M/C | L429-CVS Calibration Kit |
L429-IS | M/C | Method 429 Internal Standard Stock Solution |
L429-PAR | M/C | Method 429 Native PAH Stock Solution |
L429-RS | M/C | Method 429 Recovery Standard Stock Solution |
L429-SS | M/C | Method 429 Surrogate Standard Stock Solution |
M13-B-278-CDF | N/A | 1,3-Dibromo-2,7,8-trichloro[13C12]dibenzofuran |
M2-4:2FTS | 2708218-88-4 | Sodium 1H,1H,2H,2H-perfluoro-1-[1,2-13C2]-hexane sulfonate(4:2) |
M2-6:2FTS | 2708218-89-5 | Sodium 1H,1H,2H,2H-perfluoro-1-[1,2-13C2]-octane sulfonate(6:2) |
M2-6:2PAP | N/A | Disodium 1H,1H,2H,2H-[1,2-13C2]perfluorooctyl phosphate |
M2-8:2FTS | 2708218-90-8 | Sodium 1H,1H,2H,2H-perfluoro-1-[1,2-13C2]-decane sulfonate(8:2) |
M2-8:2PAP | N/A | Disodium 1H,1H,2H,2H-[1,2-13C2]perfluorodecyl phosphate |
M23-B-78-CDD | N/A | 2,3-Dibromo-7,8-dichloro[13C12]dibenzo-p-dioxin |
M23-B-78-CDF | N/A | 2,3-Dibromo-7,8-dichloro[13C12]dibenzofuran |
M24P-DDD | 2483736-36-1 | 1,1-Dichloro-2-[2-chloro[13C6]phenyl]-2-[4-chloro[13C6]phenyl]ethane |
M24P-DDE | 2483735-97-1 | 1,1-Dichloro-2-[2-chloro[13C6]phenyl]-2-[4-chloro[13C6]phenyl]ethene |
M24P-DDT | 1396995-26-8 | 1,1,1-Trichloro-2-[2-chloro[13C6]phenyl]-2-[4-chloro[13C6]phenyl]ethane |
M2FHET | N/A | 2-Perfluorohexyl-[1,2-13C2]-ethanol(6:2) |
M2FOET | N/A | 2-Perfluorooctyl-[1,2-13C2]-ethanol(8:2) |
M2PFHxDA | N/A | Perfluoro-n-[1,2-13C2]hexadecanoic acid |
M2PFOA | 864071-08-9 | Perfluoro-n-[1,2-13C2]octanoic acid |
M2PFTeDA | N/A | Perfluoro-n-[1,2-13C2]tetradecanoic acid |
M3-B-278-CDF | N/A | 3-Bromo-2,7,8-trichloro[13C12]dibenzofuran |
M3-CYA | 201996-37-4 | [13C3]-Cyanuric Acid |
M3-MEL | 1173022-88-2 | [13C3]-Melamine |
M3HFPO-DA | N/A | 2,3,3,3-Tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-13C3-propanoic acid (13C-GenX) |
M3PFBA | 2483735-33-5 | Perfluoro-n-[2,3,4-13C3]butanoic acid |
M3PFBS | 2708218-84-0 | Sodium perfluoro-1-[2,3,4-13C3]butanesulfonate |
M3PFHxS | 2708218-86-2 | Sodium perfluoro-1-[1,2,3-13C3]hexanesulfonate |
M3PFPeA | N/A | Perfluoro-n-[3,4,5-13C3]pentanoic acid |
M4-6:2diPAP | N/A | Sodium bis(1H,1H,2H,2H-[1,2-13C2]perfluorooctyl) phosphate |
M4-8:2diPAP | N/A | Sodium bis(1H,1H,2H,2H-[1,2-13C2]perfluorodecyl) phosphate |
M4-B-2378-CDF | N/A | 4-Bromo-2,3,7,8-tetrachloro[13C12]dibenzofuran |
M44P-DDD | 1571957-95-3 | 1,1-Dichloro-2,2-bis[4-chloro[13C6]phenyl]ethane |
M44P-DDE | 201612-50-2 | 1,1-Dichloro-2,2-bis[4-chloro[13C6]phenyl]ethene |
M44P-DDT | 104215-84-1 | 1,1,1-Trichloro-2,2-bis[4-chloro[13C6]phenyl]ethane |
M44P-DMDT | 2483735-96-0 | p,p’-[13C12]Methoxychlor |
M4H12 | N/A | 3′,4′-Dichloro-4-[13C12]biphenylol |
M4H120 | N/A | 2′,3,4′,5,5′-Pentachloro-4-[13C12]biphenylol |
M4H159 | N/A | 2′,3,3′,4′,5,5′-Hexachloro-4-[13C12]biphenylol |
M4H172 | N/A | 2,2′,3,3′,4′,5,5′-Heptachloro-4-[13C12]biphenylol |
M4H187 | N/A | 2,2′,3,4′,5,5′,6-Heptachloro-4-[13C12]biphenylol |
M4H29 | N/A | 2′,4′,5′-Trichloro-4-[13C12]biphenylol |
M4H61 | N/A | 2′,3′,4′,5′-Tetrachloro-4-[13C12]biphenylol |
M4M120 | N/A | 2,3′,4,5,5′-Pentachloro-4′-methoxy[13C12]biphenyl |
M4M159 | N/A | 2,3,3′,4,5,5′-Hexachloro-4′-methoxy[13C12]biphenyl |
M4M172 | N/A | 2,2′,3,3′,4,5,5′-Heptachloro-4′-methoxy[13C12]biphenyl |
M4M187 | N/A | 2,2′,3,4′,5,5′,6-Heptachloro-4-methoxy[13C12]biphenyl |
M4M29 | N/A | 2,4,5-Trichloro-4′-methoxy[13C12]biphenyl |
M4M61 | N/A | 2,3,4,5-Tetrachloro-4′-methoxy[13C12]biphenyl |
M4PFHpA | 2328024-55-9 | Perfluoro-n-[1,2,3,4-13C4]heptanoic acid |
M5PFHxA | 2328024-54-8 | Perfluoro-n-[1,2,3,4,6-13C5]hexanoic acid |
M5PFPeA | 2283397-79-3 | Perfluoro-n-[1,2,3,4,5-13C5]pentanoic acid |
M6-CYA | N/A | [13C3],[13N3]-Cyanuric Acid |
M6HBDE47 | N/A | 2,2′,4,4′-Tetrabromo-6-hydroxy[13C12]diphenyl ether |
M6MBDE47 | N/A | 2,2′,4,4′-Tetrabromo-6-methoxy[13C12]diphenyl ether |
M6PFDA | 2328024-56-0 | Perfluoro-n-[1,2,3,4,5,6-13C6]decanoic acid |
M6PHBDE100 | N/A | 2,2′,4,4′,6-Pentabromo-6′-hydroxy[13C12]diphenyl ether |
M6PMBDE100 | N/A | 2,2′,4,4′,6-Pentabromo-6′-methoxy[13C12]diphenyl ether |
M6TBEP | N/A | Tris(2-butoxy-[13C2]-ethyl) phosphate |
M6UV-328 | N/A | 2-[2H-(13C6)Benzotriazol-2-yl]-4,6-bis(1,1-dimethylpropyl)phenol |
M7PFUdA | N/A | Perfluoro-n-[1,2,3,4,5,6,7-13C7]undecanoic acid |
M8-B-23-CDF | N/A | 8-Bromo-2,3-dichloro[13C12]dibenzofuran |
M8FOSA-I | N/A | Perfluoro-1-[13C8]octanesulfonamide |
M8PFOA | 1350614-84-4 | Perfluoro-n-[13C8]octanoic acid |
M8PFOS | 2522762-16-7 | Sodium perfluoro-[13C8]octanesulfonate |
M9PFNA | 2283397-80-6 | Perfluoro-n-[13C9]nonanoic acid |
Ma-DP | N/A | 13C10-anti-Dechlorane Plus® |
MaENDOS | 2483736-15-6 | [13C9]Endosulfan I (alpha) |
MaHBCD | 870247-98-6 | rac-alpha-1,2,5,6,9,10-Hexabromo[13C12]cyclododecane |
MaHCH | 222966-66-7 | alpha-1,2,3,4,5,6-Hexachloro[13C6]cyclohexane |
MALD | 475274-95-4 | [13C12]Aldrin |
MBB-153 | 1401249-00-0 | 2,2′,4,4′,5,5′-Hexabromo[13C12]biphenyl |
MBB-194 | 1401249-01-1 | 2,2′,3,3′,4,4′,5,5′-Octabromo[13C12]biphenyl |
MBB-209 | N/A | Decabromo[13C12]biphenyl |
MBB-52 | 1401248-99-4 | 2,2′,5,5′-Tetrabromo[13C12]biphenyl |
MBB-MXA | M/C | Mass-Labelled PBB Solution/Mixture |
MBDD-2378 | N/A | 2,3,7,8-Tetrabromo[13C12]dibenzo-p-dioxin |
MBDE-100 | 678997-41-6 | 2,2′,4,4′,6-Pentabromo[13C12]diphenyl ether |
MBDE-126 | 1401355-56-3 | 3,3′,4,4′,5-Pentabromo[13C12]diphenyl ether |
MBDE-138 | 1401355-57-4 | 2,2′,3,4,4′,5′-Hexabromo[13C12]diphenyl ether |
MBDE-139 | 488710-25-4 | 2,2′,3,4,4′,6-Hexabromo[13C12]diphenyl ether |
MBDE-15 | 488710-17-4 | 4,4′-Dibromo[13C12]diphenyl ether |
MBDE-153 | 488710-22-1 | 2,2′,4,4′,5,5′-Hexabromo[13C12]diphenyl ether |
MBDE-154 | 488710-23-2 | 2,2′,4,4′,5,6′-Hexabromo[13C12]diphenyl ether |
MBDE-169 | 1401355-58-5 | 3,3′,4,4′,5,5′-Hexabromo[13C12]diphenyl ether |
MBDE-180 | N/A | 2,2′,3,4,4′,5,5′-Heptabromo[13C12]diphenyl ether |
MBDE-183 | 488710-24-3 | 2,2′,3,4,4′,5′,6-Heptabromo[13C12]diphenyl ether |
MBDE-197 | 1367487-31-7 | 2,2′,3,3′,4,4′,6,6′-Octabromo[13C12]diphenyl ether |
MBDE-205 | 1401355-59-6 | 2,3,3′,4,4′,5,5′,6-Octabromo[13C12]diphenyl ether |
MBDE-206 | N/A | 2,2′,3,3′,4,4′,5,5′,6-Nonabromo[13C12]diphenyl ether |
MBDE-207 | 1367487-33-9 | 2,2′,3,3′,4,4′,5,6,6′-Nonabromo[13C12]diphenyl ether |
MBDE-209 | N/A | Decabromo[13C12]diphenyl ether |
MBDE-28 | 488710-19-6 | 2,4,4′-Tribromo[13C12]diphenyl ether |
MBDE-3 | 488710-15-2 | 4-Bromo[13C12]diphenyl ether |
MBDE-47 | 488710-20-9 | 2,2′,4,4′-Tetrabromo[13C12]diphenyl ether |
MBDE-77 | 1401355-55-2 | 3,3′,4,4′-Tetrabromo[13C12]diphenyl ether |
MBDE-79 | N/A | 3,3′,4,5′-Tetrabromo[13C12]diphenyl ether |
MBDE-99 | 488710-21-0 | 2,2′,4,4′,5-Pentabromo[13C12]diphenyl ether |
MBDE-ISS-G | M/C | Mass-Labelled PBDE Internal Standard Solution |
MBDE-ISS-G-STK | M/C | Mass-Labelled PBDE Internal Standard Stock Solution |
MBDE-MXA | M/C | Mass-Labelled PBDE Solution/Mixture |
MBDE-MXB | M/C | Mass-Labelled PBDE Solution/Mixture |
MBDE-MXC | M/C | Mass-Labelled PBDE Solution/Mixture |
MBDE-MXE | M/C | Mass-Labelled PBDE Solution/Mixture |
MBDE-MXE-STK | M/C | Mass-Labelled PBDE Solution/Mixture Stock Solution |
MBDE-MXFR | M/C | Mass-Labelled PBDE Recovery Stock |
MBDE-MXFS | M/C | Mass-Labelled PBDE Surrogate Stock |
MBDE-MXG | M/C | Mass-Labelled PBDE Solution/Mixture |
MBDE-MXG-STK | M/C | Mass-Labelled PBDE Stock Solution/Mixture |
MBEHTBP | N/A | Bis(2-Ethylhexyl-d17)-tetrabromo[13C6]phthalate |
MbENDOS | 2484171-16-4 | [13C9]Endosulfan II (beta) |
MbHBCD | 870248-00-3 | rac-beta-1,2,5,6,9,10-Hexabromo[13C12]cyclododecane |
MbHCH | 222966-68-9 | beta-1,2,3,4,5,6-Hexachloro[13C6]cyclohexane |
MBP-1 | 234432-85-0 | 2-Chloro[13C12]biphenyl |
MBP-101 | 104130-39-4 | 2,2′,4,5,5′-Pentachloro[13C12]biphenyl |
MBP-104 | 234432-89-4 | 2,2′,4,6,6′-Pentachloro[13C12]biphenyl |
MBP-105 | 208263-62-1 | 2,3,3′,4,4′-Pentachloro[13C12]biphenyl |
MBP-11 | N/A | 3,3′-Dichloro[13C12]biphenyl |
MBP-111 | 235416-29-2 | 2,3,3′,5,5′-Pentachloro[13C12]biphenyl |
MBP-114 | 208263-63-2 | 2,3,4,4′,5-Pentachloro[13C12]biphenyl |
MBP-114-0.05 | N/A | Mass-Labelled PCB Solution |
MBP-118 | 104130-40-7 | 2,3′,4,4′,5-Pentachloro[13C12]biphenyl |
MBP-123 | 208263-64-3 | 2′,3,4,4′,5-Pentachloro[13C12]biphenyl |
MBP-126 | 208263-65-4 | 3,3′,4,4′,5-Pentachloro[13C12]biphenyl |
MBP-127 | N/A | 3,3′,4,5,5′-Pentachloro[13C12]biphenyl |
MBP-133 | N/A | 2,2′,3,3′,5,5′-Hexachloro[13C12]biphenyl |
MBP-138 | 208263-66-5 | 2,2′,3,4,4′,5′-Hexachloro[13C12]biphenyl |
MBP-15 | 208263-67-6 | 4,4′-Dichloro[13C12]biphenyl |
MBP-153 | 185376-58-3 | 2,2′,4,4′,5,5′-Hexachloro[13C12]biphenyl |
MBP-155 | 234432-90-7 | 2,2′,4,4′,6,6′-Hexachloro[13C12]biphenyl |
MBP-156 | 208263-68-7 | 2,3,3′,4,4′,5-Hexachloro[13C12]biphenyl |
MBP-157 | 235416-30-5 | 2,3,3′,4,4′,5′-Hexachloro[13C12]biphenyl |
MBP-159 | N/A | 2,3,3′,4,5,5′-Hexachloro[13C12]biphenyl |
MBP-162 | N/A | 2,3,3′,4′,5,5′-Hexachloro[13C12]biphenyl |
MBP-167 | 208263-69-8 | 2,3′,4,4′,5,5′-Hexachloro[13C12]biphenyl |
MBP-169 | 208263-70-1 | 3,3′,4,4′,5,5′-Hexachloro[13C12]biphenyl |
MBP-170 | 160901-80-4 | 2,2′,3,3′,4,4′,5-Heptachloro[13C12]biphenyl |
MBP-178 | 232919-67-4 | 2,2′,3,3′,5,5′,6-Heptachloro[13C12]biphenyl |
MBP-180 | 160901-82-6 | 2,2′,3,4,4′,5,5′-Heptachloro[13C12]biphenyl |
MBP-188 | 234432-91-8 | 2,2′,3,4′,5,6,6′-Heptachloro[13C12]biphenyl |
MBP-189 | 208263-73-4 | 2,3,3′,4,4′,5,5′-Heptachloro[13C12]biphenyl |
MBP-19 | 234432-87-2 | 2,2′,6-Trichloro[13C12]biphenyl |
MBP-194 | 208263-74-5 | 2,2′,3,3′,4,4′,5,5′-Octachloro[13C12]biphenyl |
MBP-202 | 105600-26-8 | 2,2′,3,3′,5,5′,6,6′-Octachloro[13C12]biphenyl |
MBP-205 | 234446-64-1 | 2,3,3′,4,4′,5,5′,6-Octachloro[13C12]biphenyl |
MBP-206 | 208263-75-6 | 2,2′,3,3′,4,4′,5,5′,6-Nonachloro[13C12]biphenyl |
MBP-208 | 234432-92-9 | 2,2′,3,3′,4,5,5′,6,6′-Nonachloro[13C12]biphenyl |
MBP-209 | 105600-27-9 | Decachloro[13C12]biphenyl |
MBP-28 | 208263-76-7 | 2,4,4′-Trichloro[13C12]biphenyl |
MBP-3 | 208263-77-8 | 4-Chloro[13C12]biphenyl |
MBP-31 | 208263-78-9 | 2,4′,5-Trichloro[13C12]biphenyl |
MBP-37 | 208263-79-0 | 3,4,4′-Trichloro[13C12]biphenyl |
MBP-4 | 234432-86-1 | 2,2′-Dichloro[13C12]biphenyl |
MBP-5 | N/A | 2,3-Dichloro[13C12]biphenyl |
MBP-52 | 208263-80-3 | 2,2′,5,5′-Tetrachloro[13C12]biphenyl |
MBP-54 | 234432-88-3 | 2,2′,6,6′-Tetrachloro[13C12]biphenyl |
MBP-60 | N/A | 2,3,4,4′-Tetrachloro[13C12]biphenyl |
MBP-70 | 208263-81-4 | 2,3′,4′,5-Tetrachloro[13C12]biphenyl |
MBP-70-(0.1) | N/A | Mass-Labelled PCB Solution |
MBP-77 | 105600-23-5 | 3,3′,4,4′-Tetrachloro[13C12]biphenyl |
MBP-79 | 1027415-81-1 | 3,3′,4,5′-Tetrachloro[13C12]biphenyl |
MBP-8 | N/A | 2,4′-Dichloro[13C12]biphenyl |
MBP-81 | 208461-24-9 | 3,4,4′,5-Tetrachloro[13C12]biphenyl |
MBP-9 | 250694-89-4 | 2,5-Dichloro[13C12]biphenyl |
MBP-95 | N/A | 2,2′,3,5′,6-Pentachloro[13C12]biphenyl |
MBP-CG | M/C | Mass-Labelled Mono to Decachloro PCB Solution/Mixture |
MBP-CP | M/C | Mass-Labelled Coplanar PCB Solution/Mixture |
MBP-D7 | M/C | Mass-Labelled PCB Congener Solution/Mixture |
MBP-MO | M/C | Mass-Labelled Mono-Ortho PCB Solution/Mixture |
MBP-MXE | M/C | Mass-Labelled PCB Solution/Mixture |
MBP-MXP | M/C | Mass-Labelled PCB Internal Standard Solution |
MBP-PG-MXA | M/C | Mass-Labelled PCB Mixture/Solution |
MBPA | 263261-65-0 | 13C12-Bisphenol A |
MBTBPE | N/A | 1,2-Bis(2,4,6-tribromo[13C6]phenoxy)ethane |
MBZ-123456 | 93952-14-8 | 13C6-Hexachlorobenzene |
MBZ-1235 | 208461-25-0 | 1,2,3,5-Tetrachloro[13C6]benzene |
MCBP-2367 | N/A | 2,3,6,7-Tetrachloro[13C12]biphenylene |
MCBS | M/C | Mass-Labelled Chlorobenzene Solution/Mixture |
McChlorD | 475275-01-5 | cis-[13C10]Chlordane (alpha) |
MCCZ-1368 | N/A | 1,3,6,8-Tetrachloro-9H-[13C12]carbazole |
MCCZ-36 | N/A | 3,6-Dichloro-9H-[13C12]carbazole |
MCCZ-MIX-A | M/C | Solution/Mix of Mass-Labelled Chlorinated Carbazoles |
MCDD-2378 | 85508-50-5 | 2,3,7,8-[37Cl4]-Tetrachlorodibenzo-p-dioxin |
MCDE-0 | 2483735-44-8 | [13C12]Diphenyl ether |
MCDE-12 | N/A | 3,4-Dichloro[13C12]diphenyl ether |
MCDE-141 | N/A | 2,2′,3,4,5,5′-Hexachloro[13C12]diphenyl ether |
MCDE-180 | N/A | 2,2′,3,4,4′,5,5′-Heptachloro[13C12]diphenyl ether |
MCDE-3 | N/A | 4-Chloro[13C12]diphenyl ether |
MCDE-37 | N/A | 3,4,4′-Trichloro[13C12]diphenyl ether |
MCDE-61 | N/A | 2,3,4,5-Tetrachloro[13C12]diphenyl ether |
MCDE-86 | 1621005-50-2 | 2,2′,3,4,5-Pentachloro[13C12]diphenyl ether |
McNChlor | 2484171-06-2 | cis-[13C10]Nonachlor |
MCP-23456 | 85380-74-1 | Pentachloro[13C6]phenol |
MCP-246 | 208461-28-3 | 2,4,6-Trichloro[13C6]phenol |
MCP-25 | 2483735-42-6 | 2,5-Dichloro[13C6]phenol |
MCP-345 | 208461-30-7 | 3,4,5-Trichloro[13C6]phenol |
MCPS | M/C | Mass-Labelled Chlorophenol Solution/Mixture |
MD5CWDS | M/C | PCDD Window Defining Mixture for DB5/BP5/HP2/Rtx-5/SPB-5 |
MDBDPE | N/A | 1,2-Bis(pentabromophenyl)ethane [13C14] |
MDD-0 | 125749-32-8 | [13C12]Dibenzo-p-dioxin |
MDD-1234 | 114423-99-3 | 1,2,3,4-Tetrachloro[13C12]dibenzo-p-dioxin |
MDD-123467 | N/A | 1,2,3,4,6,7-Hexachloro[13C12]dibenzo-p-dioxin |
MDD-1234678 | 109719-83-7 | 1,2,3,4,6,7,8-Heptachloro[13C12]dibenzo-p-dioxin |
MDD-12346789 | 114423-97-1 | Octachloro[13C12]dibenzo-p-dioxin |
MDD-1234679 | N/A | 1,2,3,4,6,7,9-Heptachloro[13C12]dibenzo-p-dioxin |
MDD-123468 | N/A | 1,2,3,4,6,8-Hexachloro[13C12]dibenzo-p-dioxin |
MDD-123478 | 109719-80-4 | 1,2,3,4,7,8-Hexachloro[13C12]dibenzo-p-dioxin |
MDD-123678 | 109719-81-5 | 1,2,3,6,7,8-Hexachloro[13C12]dibenzo-p-dioxin |
MDD-12378 | 109719-79-1 | 1,2,3,7,8-Pentachloro[13C12]dibenzo-p-dioxin |
MDD-123789 | 109719-82-6 | 1,2,3,7,8,9-Hexachloro[13C12]dibenzo-p-dioxin |
MDD-12389 | N/A | 1,2,3,8,9-Pentachloro[13C12]dibenzo-p-dioxin |
MDD-124679 | N/A | 1,2,4,6,7,9-Hexachloro[13C12]dibenzo-p-dioxin |
MDD-12478 | N/A | 1,2,4,7,8-Pentachloro[13C12]dibenzo-p-dioxin |
MDD-12479 | N/A | 1,2,4,7,9-Pentachloro[13C12]dibenzo-p-dioxin |
MDD-1278 | N/A | 1,2,7,8-Tetrachloro[13C12]dibenzo-p-dioxin |
MDD-1289 | N/A | 1,2,8,9-Tetrachloro[13C12]dibenzo-p-dioxin |
MDD-1368 | N/A | 1,3,6,8-Tetrachloro[13C12]dibenzo-p-dioxin |
MDD-1378 | N/A | 1,3,7,8-Tetrachloro[13C12]dibenzo-p-dioxin |
MDD-2 | N/A | 2-Chloro[13C12]dibenzo-p-dioxin |
MDD-23 | N/A | 2,3-Dichloro[13C12]dibenzo-p-dioxin |
MDD-237 | N/A | 2,3,7-Trichloro[13C12]dibenzo-p-dioxin |
MDD-2378 | 76523-40-5 | 2,3,7,8-Tetrachloro[13C12]dibenzo-p-dioxin |
MDD-27 | N/A | 2,7-Dichloro[13C12]dibenzo-p-dioxin |
MDD-28 | N/A | 2,8-Dichloro[13C12]dibenzo-p-dioxin |
MDDF-MDT | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
MDELD | 475274-96-5 | [13C12]Dieldrin |
MDET-MXA | M/C | Mass-Labelled DDT & Related Compound Solution/Mixture |
MDF-0 | N/A | [13C12]Dibenzofuran |
MDF-1234 | N/A | 1,2,3,4-Tetrachloro[13C12]dibenzofuran (98%) |
MDF-12346 | N/A | 1,2,3,4,6-Pentachloro[13C12]dibenzofuran |
MDF-12346-1 | N/A | 1,2,3,4,6-Pentachloro[13C12]dibenzofuran |
MDF-1234678 | 109719-84-8 | 1,2,3,4,6,7,8-Heptachloro[13C12]dibenzofuran |
MDF-12346789 | 109719-78-0 | Octachloro[13C12]dibenzofuran |
MDF-1234689 | N/A | 1,2,3,4,6,8,9-Heptachloro[13C12]dibenzofuran |
MDF-1234689-1 | N/A | 1,2,3,4,6,8,9-Heptachloro[13C12]dibenzofuran |
MDF-123469 | N/A | 1,2,3,4,6,9-Hexachloro[13C12]dibenzofuran |
MDF-123469-1 | N/A | 1,2,3,4,6,9-Hexachloro[13C12]dibenzofuran |
MDF-123478 | 114423-98-2 | 1,2,3,4,7,8-Hexachloro[13C12]dibenzofuran |
MDF-1234789 | 109719-94-0 | 1,2,3,4,7,8,9-Heptachloro[13C12]dibenzofuran |
MDF-123489 | N/A | 1,2,3,4,8,9-Hexachloro[13C12]dibenzofuran |
MDF-123678 | 116843-03-9 | 1,2,3,6,7,8-Hexachloro[13C12]dibenzofuran |
MDF-12378 | 109719-77-9 | 1,2,3,7,8-Pentachloro[13C12]dibenzofuran |
MDF-123789 | 116843-04-0 | 1,2,3,7,8,9-Hexachloro[13C12]dibenzofuran |
MDF-12389 | N/A | 1,2,3,8,9-Pentachloro[13C12]dibenzofuran |
MDF-1278 | N/A | 1,2,7,8-Tetrachloro[13C12]dibenzofuran |
MDF-1278-1 | N/A | 1,2,7,8-Tetrachloro[13C12]dibenzofuran |
MDF-13468 | N/A | 1,3,4,6,8-Pentachloro[13C12]dibenzofuran |
MDF-1368 | N/A | 1,3,6,8-Tetrachloro[13C12]dibenzofuran |
MDF-2 | N/A | 2-Chloro[13C12]dibenzofuran |
MDF-23 | N/A | 2,3-Dichloro[13C12]dibenzofuran |
MDF-234678 | 116843-05-1 | 2,3,4,6,7,8-Hexachloro[13C12]dibenzofuran |
MDF-23478 | 116843-02-8 | 2,3,4,7,8-Pentachloro[13C12]dibenzofuran |
MDF-2378 | 89059-46-1 | 2,3,7,8-Tetrachloro[13C12]dibenzofuran |
MDF-238 | N/A | 2,3,8-Trichloro[13C12]dibenzofuran |
MdHCH | N/A | delta-1,2,3,4,5,6-Hexachloro[13C6]cyclohexane |
MEHTBB | N/A | 2-Ethylhexyl-d17-2,3,4,5-tetrabromo[13C6]benzoate |
MEL | 108-78-1 | Melamine |
MEND | 475274-99-8 | [13C12]Endrin |
MENDOS-S | N/A | [13C9]Endosulfan Sulfate |
MeOBDES | M/C | Methoxy-Bromodiphenyl Ethers Solution/Mixture |
MeTBBA | 1448844-87-8 | Methyl-2,3,4,5-tetrabromobenzoate |
MeTCS | 4640-01-1 | 5-Chloro-2-(2,4-dichlorophenoxy)anisole |
MF5CWDS | M/C | PCDF Window Defining Mixture for DB5/BP5/HP2/Rtx-5/SPB-5 |
MFBET | N/A | 2-Perfluorobutyl-[1,1,2,2-2H4]-ethanol(4:2) |
MFDEA | 872398-77-1 | 2-Perfluorodecyl-[1,2-13C2]-ethanoic acid(10:2) |
MFDET | 872398-74-8 | 2-Perfluorodecyl-[1,1-2H2]-[1,2-13C2]-ethanol(10:2) |
MFDUEA | 872398-80-6 | 2H-Perfluoro-2-[1,2-13C2]-dodecenoic acid(10:2) |
MFHEA | 872398-75-9 | 2-Perfluorohexyl-[1,2-13C2]-ethanoic acid(6:2) |
MFHET | 872398-72-6 | 2-Perfluorohexyl-[1,1-2H2]-[1,2-13C2]-ethanol(6:2) |
MFHUEA | 872398-78-2 | 2H-Perfluoro-2-[1,2-13C2]-octenoic acid(6:2) |
MFOEA | 872398-76-0 | 2-Perfluorooctyl-[1,2-13C2]-ethanoic acid(8:2) |
MFOET | 872398-73-7 | 2-Perfluorooctyl-[1,1-2H2]-[1,2-13C2]-ethanol(8:2) |
MFOUEA | 872398-79-3 | 2H-Perfluoro-2-[1,2-13C2]-decenoic acid(8:2) |
MFTA-MXA | M/C | Mass-Labelled FTA Solution/Mixture |
MgHBCD | 676552-82-2 | rac-gamma-1,2,5,6,9,10-Hexabromo[13C12]cyclododecane |
MgHCH | 104215-85-2 | gamma-1,2,3,4,5,6-Hexachloro[13C6]cyclohexane |
MHBBZ | 2483735-50-6 | Hexabromo[13C6]benzene |
MHBCD-MXA | M/C | 13C-Labelled HBCD Mixture |
MHCH-MXA | M/C | Mass-Labelled HCH Solution/Mixture |
MHPCB-MXA | M/C | Mass-Labelled Chlorinated Biphenylol Solution/Mixture |
MHpChlor | N/A | [13C10]Heptachlor |
MHpChlor-xEp | 2483736-00-9 | [13C10]Heptachlor-exo-epoxide (isomer B) |
MHxCB | 93952-14-8 | Hexachloro[13C6]benzene |
MHxChlor | N/A | [13C10]Chlordene |
MISOD | 475274-98-7 | [13C12]Isodrin |
MKEP | 2483736-05-4 | [13C10]Kepone |
MMeTCS | N/A | 5-Chloro-2-(2,4-dichloro[13C6]phenoxy)[1,2,3,4,5,6-13C6]anisole |
MMPCB-MXA | M/C | Mass-Labelled Chlorinated Methoxybiphenyl Solution/Mixture |
MMRX | 2483736-04-3 | [13C10]Mirex |
MOCP-MXA | M/C | Mass-Labelled OC Pesticide Solution/Mixture |
MOxyChlorD | 2483735-99-3 | [13C10]Oxychlordane |
MPBBZ | N/A | Pentabromo[13C6]benzene |
MPCB-MXA | M/C | Native Chlorinated Methoxybiphenyl Solution/Mixture |
MPCB-MXB | M/C | Native Chlorinated Methoxybiphenyl Solution/Mixture |
MPCB-MXC | M/C | Native Chlorinated Methoxybiphenyl Solution/Mixture |
MPCB-MXD | M/C | Native Chlorinated Methoxybiphenyl Solution/Mixture |
MPCB-MXE | M/C | Native Chlorinated Methoxybiphenyl Solution/Mixture |
MPCB-MXF | M/C | Native Chlorinated Methoxybiphenyl Solution/Mixture |
MPCB-MXG | M/C | Native Chlorinated Methoxybiphenyl Solution/Mixture |
MPCB-MXH | M/C | Native Chlorinated Methoxybiphenyl Solution/Mixture |
MPCB-MXI | M/C | Native Chlorinated Methoxybiphenyl Solution/Mixture |
MPeCB | 2483735-54-0 | Pentachloro[13C6]benzene |
MPFAC-24ES | M/C | Mass-Labelled PFAS Extraction Standard Solution |
MPFAC-C-ES | M/C | Mass-Labelled PFC Extraction Standards Solution |
MPFAC-C-IS | M/C | Mass-Labelled PFC Injection Standards Solution |
MPFAC-HIF-ES | M/C | Mass-Labelled PFAS Extraction Standard Solution/Mixture for U.S. EPA Method 1633 |
MPFAC-HIF-IS | M/C | Mass-Labelled PFAS Injection Standard Solution/Mixture for U.S. EPA Method 1633 |
MPFAC-MXA | M/C | Mass-Labelled PFCAs and PFASs Solution/Mixture |
MPFBA | 1017281-29-6 | Perfluoro-n-[1,2,3,4-13C4]butanoic acid |
MPFDA | 960315-50-8 | Perfluoro-n-[1,2-13C2]decanoic acid |
MPFDoA | 960315-52-0 | Perfluoro-n-[1,2-13C2]dodecanoic acid |
MPFHxA | 960315-47-3 | Perfluoro-n-[1,2-13C2]hexanoic acid |
MPFHxS | N/A | Sodium perfluoro-1-hexane[18O2]sulfonate |
MPFNA | 960315-49-5 | Perfluoro-n-[1,2,3,4,5-13C5]nonanoic acid |
MPFOA | N/A | Perfluoro-n-[1,2,3,4-13C4]octanoic acid |
MPFOS | 960315-53-1 | Sodium perfluoro-1-[1,2,3,4-13C4]octanesulfonate |
MPFUdA | 960315-51-9 | Perfluoro-n-[1,2-13C2]undecanoic acid |
MPN-1 | N/A | 1-Chloro[13C10]naphthalene |
MPN-23 | N/A | 1,4,5-Trichloro[13C10]naphthalene |
MPN-24 | N/A | 1,4,6-Trichloro[13C10]naphthalene |
MPN-48 | N/A | 2,3,6,7-Tetrachloro[13C10]naphthalene |
MPN-5 | N/A | 1,4-Dichloro[13C10]naphthalene |
MPN-54 | N/A | 1,2,3,6,7-Pentachloro[13C10]naphthalene |
MPN-56 | N/A | 1,2,3,7,8-Pentachloro[13C10]naphthalene |
MPN-59 | N/A | 1,2,4,5,8-Pentachloro[13C10]naphthalene |
MPN-67 | 219526-47-3 | 1,2,3,5,6,7-Hexachloro[13C10]naphthalene |
MPN-70 | N/A | 1,2,3,6,7,8-Hexachloro[13C10]naphthalene |
MPN-72 | N/A | 1,2,4,5,7,8-Hexachloro[13C10]naphthalene |
MPN-73 | 219526-49-5 | 1,2,3,4,5,6,7-Heptachloro[13C10]naphthalene |
MPN-74 | N/A | 1,2,3,4,5,6,8-Heptachloro[13C10]naphthalene |
MPN-75 | 219526-50-8 | Octachloro[13C10]naphthalene |
MRX | 2385-85-5 | Mirex |
MT4CPM | N/A | Tris(4-chlorophenyl)methane-[13C19] |
MT4CPME | N/A | Tris(4-chlorophenyl)methanol-[13C19] |
MTBBA | 2710628-49-0 | 2,3,4,5-Tetrabromobenzoic acid [13C6-ring] |
MTBBPA | N/A | 3,3′,5,5′-Tetrabromobisphenol-A [rings; 13C12] |
MTBPAn | N/A | Tetrabromo[13C6]phthalic anhydride |
MTCC | N/A | N-(4-chloro[13C6]phenyl)-N’-(3,4-dichloro[13C6]phenyl)[13C]urea |
MTCDT-85 | N/A | 2,4,6,8-Tetrachloro[13C12]dibenzothiophene |
MtChlorD | 1262969-05-0 | trans-[13C10]Chlordane (gamma) |
MTCS | 1365620-36-5 | 5-Chloro-2-(2,4-dichloro[13C6]phenoxy)[13C6]phenol |
MTCS-M | 1365620-36-5 | 5-Chloro-2-(2,4-dichloro[13C6]phenoxy)[13C6]phenol |
MtNChlor | 1262969-06-1 | trans-[13C10]Nonachlor |
MTPP | N/A | 13C18-Triphenyl phosphate |
N,N-Me2FOSA-M | 213181-78-3 | N,N-dimethylperfluoro-1-octanesulfonamide |
N-AP-FHxSA | 50598-28-2 | N-(3-(dimethylaminopropan-1-yl)perfluoro-1-hexanesulfonamide |
N-CMAmP-6:2FOSA | 34455-29-3 | N-(carboxymethyl)N,N-dimethyl-N-[3-(1H,1H,2H,2H-perfluoro-1-octanesulfonamido)propan-1-yl]ammonium (6:2FTAB or Capstone B) |
N-EtFBSA-M | 40630-67-9 | N-Ethylperfluoro-1-butanesulfonamide |
N-EtFBSE-M | 34449-89-3 | 2-(N-Ethylperfluoro-1-butanesulfonamido)ethanol |
N-EtFOSA-M | 4151-50-2 | N-ethylperfluoro-1-octanesulfonamide |
N-EtFOSAA | 2991-50-6 | N-ethylperfluoro-1-octanesulfonamidoacetic acid |
N-EtFOSE-M | 1691-99-2 | 2-(N-ethylperfluoro-1-octanesulfonamido)-ethanol |
N-MeFBSA-M | 68298-12-4 | N-methylperfluoro-1-butanesulfonamide |
N-MeFBSE-M | 34454-97-2 | 2-(N-methylperfluoro-1-butanesulfonamido)ethanol |
N-MeFOSA-M | 31506-32-8 | N-methylperfluoro-1-octansulfonamide |
N-MeFOSAA | 2355-31-9 | N-methylperfluoro-1-octanesulfonamidoacetic acid |
N-MeFOSE-M | 24448-09-7 | 2-(N-methylperfluoro-1-octanesulfonamido)-ethanol |
N-TAmP-FHxSA | 38850-51-0 | N-[3-(perfluoro-1-hexanesulfonamido)propan-1-yl]-N,N,N-trimethylammonium |
NaDONA | 2250081-67-3 | Sodium dodecafluoro-3H-4,8-dioxanonanoate (ADONA CAS 958445-44-8 ) |
NaP3MHpS | 1202827-34-6 | Sodium perfluoro-3-methylheptanesulfonate |
NaP6MHpS | 1202827-38-0 | Sodium perfluoro-6-methylheptanesulfonate |
NK-CVS-J | M/C | PCDD & PCDF Calibration Kit |
NK-IS-D | M/C | Mass-Labelled PCDD/PCDF Internal Standard Solution |
NK-IS-J4 | M/C | Internal Standard Solution |
NK-IS-J5 | M/C | Internal Standard Solution |
NK-LCS-A | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
NK-LCS-A1 | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
NK-LCS-G | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
NK-LCS-I | M/C | Mass-Labelled PCDD/PCDF Solution/Mixture |
NK-LCS-O | M/C | Mass-Labelled PCDD/PCDF Solution Mixture |
NK-LCS-T | M/C | Mass-Labelled PCDD/PCDF Solution Mixture |
NK-MBP-MXC | M/C | Solution/Mixture of Mass-Labelled PCBs |
NK-ST-A | M/C | Native PCDD/PCDF Solution/Mixture |
NK-ST-A4 | M/C | Native PCDD/PCDF Solution/Mixture |
NK-ST-B2 | M/C | Native PCDD/PCDF Solution/Mixture |
NK-ST-B3 | M/C | Native PCDD/PCDF Solution/Mixture |
NK-ST-B4 | M/C | Native PCDD/PCDF Solution/Mixture |
OBIND | 155613-93-7 | 4,5,6,7-Tetrabromo-1,1,3-trimethyl-3-(2,3,4,5-tetrabromophenyl)-indane |
OCP-MXA | M/C | Native OC Pesticide Solution/Mixture |
OIL-CVS-B | M/C | CS1/CS2/CS3/CS4/CS5/CS6 |
OxyChlorD | 27304-13-8 | OxyChlordane |
P1MHpS | N/A | Perfluoro-1-methylheptane sulfonate |
P355TMHxA | 238403-51-5 | Perfluoro-3,5,5-trimethylhexanoic acid |
P37DMOA | 172155-07-6 | Perfluoro-3,7-dimethyloctanoic acid |
P3MHpA | 705240-04-6 | Perfluoro-3-methylheptanoic acid |
P3MHpS | M/C | Perfluoro-3-methylheptane sulfonate; |
P45DMHxS | M/C | Perfluoro-4,5-dimethylhexane sulfonate; |
P48-M-CVS | M/C | Calibration Kit for Marker PCBs; EN 1948-4:2010 |
P48-M-ES | M/C | Marker PCB Extraction Standard |
P48-M-PAR | M/C | Precision and Recovery Stock Solution: Marker PCBs |
P48-M-PAR-STK | M/C | Native Marker PCB Stock Solution |
P48-RS | M/C | Mass-Labelled PCB Recovery Standard |
P48-RS-STK | M/C | Mass-Labelled PCB Recovery Standard Stock Solution |
P48-SS | M/C | Mass-Labelled PCB Sampling Standard |
P48-SS-STK | M/C | Mass-Labelled PCB Sampling Standard Stock Solution |
P48-W-CVS | M/C | Calibration Kit for WHO (Dioxin-like) PCBs; EN 1948-4:2010 |
P48-W-ES | M/C | WHO PCB Extraction Standard |
P48-W-ES-STK | M/C | WHO PCB Extraction Standard Stock Solution |
P48-W-PAR | M/C | Precision and Recovery Stock Solution: WHO PCBs |
P4MHpS | M/C | Perfluoro-4-methylheptane sulfonate; |
P4MOA | N/A | Perfluoro-4-methyloctanoic acid |
P55DMHxS | M/C | Perfluoro-5,5-dimethylhexane sulfonate; |
P5MHpS | M/C | Perfluoro-5-methylheptane sulfonate; |
P6MHpS | M/C | Perfluoro-6-methylheptane sulfonate; |
PAH-CVS-B | M/C | PAH-CVS-B Calibration Kit |
PAH-ISS-B | M/C | PAH Internal Standard Spiking Solution |
PAH-LCS-B | M/C | PAH Labelled Compound Solution |
PAH-SS-B | M/C | PAH Sampling Standard Solution |
PAH-STK-B | M/C | PAH Native Stock Solution |
PBB-MXA | M/C | Native PBB Solution/Mixture |
PBBA | 59447-55-1 | Pentabromobenzyl acrylate |
PBBZ | 608-90-2 | Pentabromobenzene |
PBCD | N/A | rac-(1,5R,6S,9S,10R)-pentabromocyclododecene |
PBEB | 85-22-3 | Pentabromoethylbenzene |
PBT | 87-83-2 | Pentabromotoluene |
PCB-B10-CS8 | M/C | High Level Calibration Solution |
PCB-B10-CS8 | M/C | High Level Calibration Solution |
PCB-CVS-A10 | M/C | PCB HRGC/HRMS Calibration and Verification Solutions |
PCB-CVS-A5 | M/C | PCB HRGC/HRMS Calibration and Verification Solutions |
PCB-CVS-B10 | M/C | PCB HRGC/HRMS Calibration and Verification Solutions |
PCB-CVS-B10 | M/C | CS1/CS2/CS3/CS4/CS5/CS6 |
PCB-CVS-H | M/C | Calibration Kit for HRGC/HRMS Analysis of PCBs |
PCB-CVS-JQ | M/C | PCB HRGC/HRMS Calibration and Verification Solutions |
PCB-IS-A | M/C | Mass-Labelled PCB Solution |
PCB-IS-A100 | M/C | Mass-Labelled PCB Solution |
PCB-IS-A20 | M/C | Mass-Labelled PCB Solution |
PCB-IS-B | M/C | Mass-Labelled PCB Solution/Mixture |
PCB-IS-B100 | M/C | Mass-Labelled PCB Solution/Mixture |
PCB-IS-B20 | M/C | Mass-Labelled PCB Solution/Mixture |
PCB-IS-C | M/C | Mass-Labelled PCB Syringe Spike Solution |
PCB-IS-C | M/C | Mass-Labelled PCBs Syringe Spike Solution |
PCB-IS-C100 | M/C | Mass-Labelled PCB Syringe Spike Solution |
PCB-IS-C100 | M/C | Mass-Labelled PCBs Syringe Spike Solution |
PCB-IS-C20 | M/C | Mass-Labelled PCB Syringe Spike Solution |
PCB-IS-C20 | M/C | Mass-Labelled PCBs Syringe Spike Solution |
PCB-ISS-H | M/C | Mass-Labelled PCB Internal/Recovery Standards |
PCB-LCS-A | M/C | Mass-Labelled PCB Solution/Mixture |
PCB-LCS-A1 | M/C | Mass-Labelled PCB Solution/Mixture |
PCB-LCS-A1 | M/C | Mass-Labelled PCBs Solution/Mixture |
PCB-LCS-A100 | M/C | Mass-Labelled PCB Solution/Mixture |
PCB-LCS-A100 | M/C | Mass-Labelled PCBs Solution/Mixture |
PCB-LCS-A20 | M/C | Mass-Labelled PCB Solution/Mixture |
PCB-LCS-A20 | M/C | Mass-Labelled PCBs Solution/Mixture |
PCB-LCS-A200 | M/C | Mass-Labelled PCB Solution/Mixture |
PCB-LCS-H | M/C | Mass-Labelled PCB Extraction Standards |
PCB-PAR-H | M/C | Native PCB Solution |
PCB-SCS-H | M/C | Mass-Labelled PCB Cleanup/Sampling Standards |
PCB-SS-A | M/C | Mass-Labelled PCB Solution |
PCB-SS-A | M/C | Mass-Labelled PCB Sampling Spike Solution |
PCB-SS-A100 | M/C | Mass-Labelled PCB Solution |
PCB-SS-A100 | M/C | Mass-Labelled PCB Sampling Spike Solution |
PCB-SS-A20 | M/C | Mass-Labelled PCB Solution |
PCB-SS-A20 | M/C | Mass-Labelled PCB Sampling Spike Solution |
PCB-ST-A | M/C | Native PCB Stock Solution |
PCB-ST-A10 | M/C | Native PCB Stock Solution |
PCB-ST-A2 | M/C | Native PCB Stock Solution |
PCB-ST-C | M/C | Native PCB Solution/Mixture |
PCB-ST-C20 | M/C | Native DL-PCBs Solution/Mixture |
PCB-ST-D | M/C | Native PCB Solution/Mixture |
PCN-CVS-A | M/C | PCN-CVS-A Calibration Kit |
PCN-HWX | M/C | PCN Major Halowax Congeners Solution/Mixture |
PCN-INC | M/C | PCN Major Incineration Congeners Solution/Mixture |
PCN-ISS-A | M/C | PCN Injection Standard Solution |
PCN-LCS-A | M/C | PCN Extraction Standard Solution |
PCN-MXA | M/C | Native PCN Solution/Mixture |
PCN-MXC | M/C | Native PCN Solution/Mixture |
PCN-SS-A | M/C | PCN Sampling Standard Solution |
PCN-STK-A | M/C | PCN Native Stock Solution |
PCN-TOX | M/C | PCN Potentially Toxic Congeners Solution/Mixture |
PCN-WD | M/C | PCN Window Defining Solution/Mixture |
PeCB | 608-93-5 | Pentachlorobenzene |
PF4OPeA | 377-73-1 | Perfluoro-4-oxapentanoic acid (PFMPA) |
PF5OHxA | 863090-89-5 | Perfluoro-5-oxahexanoic acid (PFMBA) |
PFAC-24PAR | M/C | Native PFAS Precision and Recovery Standard Solution (containing brPFHxS & brPFOS) |
PFAC-MXA | M/C | Native PFCAs and PFASs Solution/Mixture |
PFAC-MXB | M/C | Native PFCAs and PFASs Solution/Mixture |
PFAC-MXC | M/C | Native PFC Stock Solution |
PFAC-MXF | M/C | Native Replacement PFAS Solution/Mixture |
PFAC-MXG | M/C | Native Perfluoroether-Carboxylic Acids and -Sulfonate Solution/Mixture |
PFAC-MXH | M/C | Native PFAS Solution/Mixture |
PFAC-MXI | M/C | Native N-Me/EtFOSA & N-Me/EtFOSE Solution/Mixture |
PFAC-MXJ | M/C | Native X:3 Fluorotelomer Carboxylic Acid Solution/Mixture |
PFAC30PAR | M/C | Native PFAS Precision and Recovery Standard Solution |
PFBA | 375-22-4 | Perfluoro-n-butanoic acid |
PFC-CVS-C | M/C | PFC-CVS-C Calibration Kit |
PFC-MXA | M/C | Native PFCA Solution/Mixture |
PFDA | 335-76-2 | Perfluoro-n-decanoic acid |
PFDoA | 307-55-1 | Perfluoro-n-dodecanoic acid |
PFDPA | 52299-26-0 | Perfluorodecylphosphonic acid |
PFECHS | 335-24-0 | Potassium perfluoro-4-ethylcyclohexanesulfonate (isomeric mixture) |
PFEESA | 117205-07-9 | Potassium perfluoro(2-ethoxyethane)sulfonate |
PFEtS | 2923-21-9 | Sodium perfluoroethanesulfonate |
PFHpA | 375-85-9 | Perfluoro-n-heptanoic acid |
PFHxA | 307-24-4 | Perfluoro-n-hexanoic acid |
PFHxDA | 67905-19-5 | Perfluoro-n-hexadecanoic acid |
PFHxPA | 40143-76-8 | Perfluorohexylphosphonic acid |
PFMeS | 2926-30-9 | Sodium trifluoromethanesulfonate |
PFNA | 375-95-1 | Perfluoro-n-nonanoic acid |
PFOA | 335-67-1 | Perfluoro-n-octanoic acid |
PFODA | 16517-11-6 | Perfluoro-n-octadecanoic acid |
PFOPA | 40143-78-0 | Perfluorooctylphosphonic acid |
PFPeA | 2706-90-3 | Perfluoro-n-pentanoic acid |
PFPrA | 422-64-0 | Perfluoropropanoic acid |
PFS-MXA | M/C | Native PFAS Solution/Mixture |
PFTeDA | 376-06-7 | Perfluoro-n-tetradecanoic acid |
PFTrDA | 72629-94-8 | Perfluoro-n-tridecanoic acid |
PFUdA | 2058-94-8 | Perfluoro-n-undecanoic acid |
PN-12S | 2198-77-8 | 2,7-Dichloronaphthalene |
PN-13S | 50402-52-3 | 1,2,3-Trichloronaphthalene |
PN-17S | 55720-34-8 | 1,2,7-Trichloronaphthalene |
PN-18S | 55720-35-9 | 1,2,8-Trichloronaphthalene |
PN-19S | 51570-43-5 | 1,3,5-Trichloronaphthalene |
PN-1S | 90-13-1 | 1-Chloronaphthalene |
PN-20S | 55720-36-0 | 1,3,6-Trichloronaphthalene |
PN-21S | 55720-37-1 | 1,3,7-Trichloronaphthalene |
PN-23S | 2437-55-0 | 1,4,5-Trichloronaphthalene |
PN-24S | 2737-54-9 | 1,4,6-Trichloronaphthalene |
PN-27S | 20020-02-4 | 1,2,3,4-Tetrachloronaphthalene |
PN-28S | 53555-63-8 | 1,2,3,5-Tetrachloronaphthalene |
PN-2S | 91-58-7 | 2-Chloronaphthalene |
PN-31S | 149864-81-3 | 1,2,3,8-Tetrachloronaphthalene |
PN-33S | 51570-45-7 | 1,2,4,6-Tetrachloronaphthalene |
PN-34S | 67922-21-8 | 1,2,4,7-Tetrachloronaphthalene |
PN-35S | 6529-87-9 | 1,2,4,8-Tetrachloronaphthalene |
PN-36S | 67922-22-9 | 1,2,5,6-Tetrachloronaphthalene |
PN-37S | 67922-23-0 | 1,2,5,7-Tetrachloronaphthalene |
PN-40S | 67922-24-1 | 1,2,6,8-Tetrachloronaphthalene |
PN-41S | 149864-82-4 | 1,2,7,8-Tetrachloronaphthalene |
PN-42S | 53555-64-9 | 1,3,5,7-Tetrachloronaphthalene |
PN-46S | 3432-57-3 | 1,4,5,8-Tetrachloronaphthalene (>96%) |
PN-48S | 34588-40-4 | 2,3,6,7-Tetrachloronaphthalene |
PN-4S | 2198-75-6 | 1,3-Dichloronaphthalene |
PN-50S | 67922-26-3 | 1,2,3,4,6-Pentachloronaphthalene |
PN-52S | 53555-65-0 | 1,2,3,5,7-Pentachloronaphthalene |
PN-53S | 150224-24-1 | 1,2,3,5,8-Pentachloronaphthalene |
PN-54S | 150224-16-1 | 1,2,3,6,7-Pentachloronaphthalene |
PN-56S | 150205-21-3 | 1,2,3,7,8-Pentachloronaphthalene |
PN-57S | 150224-20-7 | 1,2,4,5,6-Pentachloronaphthalene |
PN-59S | 150224-25-2 | 1,2,4,5,8-Pentachloronaphthalene |
PN-5S | 1825-31-6 | 1,4-Dichloronaphthalene |
PN-63S | 58877-88-6 | 1,2,3,4,5,6-Hexachloronaphthalene |
PN-66S | 103426-96-6 | 1,2,3,4,6,7-Hexachloronaphthalene |
PN-68S | 103426-95-5 | 1,2,3,5,6,8-Hexachloronaphthalene |
PN-69S | 103426-94-4 | 1,2,3,5,7,8-Hexachloronaphthalene |
PN-6S | 1825-30-5 | 1,5-Dichloronaphthalene |
PN-70S | 17062-87-2 | 1,2,3,6,7,8-Hexachloronaphthalene |
PN-72S | 103426-92-2 | 1,2,4,5,7,8-Hexachloronaphthalene |
PN-73S | 58863-14-2 | 1,2,3,4,5,6,7-Heptachloronaphthalene |
PN-74S | 58863-15-3 | 1,2,3,4,5,6,8-Heptachloronaphthalene |
PN-75S | 2234-13-1 | Octachloronaphthalene |
PN-9S | 2050-74-0 | 1,8-Dichloronaphthalene |
pTBX | 23488-38-2 | 2,3,5,6-Tetrabromo-p-xylene |
s-DP | 135821-03-3 | syn-Dechlorane Plus |
SAmPAP | 2624-80-8 | Disodium 2-(N-ethylperfluorooctane-1-sulfonamido)ethyl phosphate |
T-PFOA | 3825-26-1 | Technical Ammonium Perfluorooctanoate |
T-PFOS | N/A | Potassium perfluorooctanesulfonate (Technical Grade) |
T23BPIC | 52434-90-9 | Tris(2,3-dibromopropyl)isocyanurate |
T24DtBPP | 95906-11-9 | Tris(2,4-di-tert-butylphenyl) phosphate |
T2IPPP | 64532-95-2 | Tris(2-isopropylphenyl) phosphate |
T34DMPP | 3862-11-1 | Tris(3,4-dimethylphenyl) phosphate |
T35DMPP | 25653-16-1 | Tris(3,5-dimethylphenyl) phosphate |
T3IPPP | 72668-27-0 | Tris(3-isopropylphenyl) phosphate |
T3tBPP | N/A | Tris(3-tert-butylphenyl) phosphate |
T4CPM | 27575-78-6 | Tris(4-chlorophenyl)methane |
T4CPME | 3010-80-8 | Tris(4-chlorophenyl)methanol |
T4IPPP | 2502-15-0 | Tris(4-isopropylphenyl) phosphate |
T4tBPP | 78-33-1 | Tris(4-tert-butylphenyl) phosphate |
TBB-809D | 27753-52-2 | Chemische Fabrik Kalk Bromkal80-9D Nonabromobiphenyl |
TBB-BP6 | 59536-65-1 | Great Lakes Chemical Firemaster BP-6 Hexabromobiphenyl |
TBBA | 27581-13-1 | 2,3,4,5-Tetrabromobenzoic acid |
TBBPA | 79-94-7 | 3,3′,5,5′-Tetrabromobisphenol-A |
TBCT | 39569-21-6 | Tetrabromo-o-chlorotoluene |
TBDE-71 | 32534-81-9 | Great Lakes Chemical DE-71Ôäó Pentabromodiphenyl Oxide |
TBDE-79 | 32536-52-0 | Great Lakes Chemical DE-79Ôäó Octabromodiphenyl Oxide |
TBDE-83R | 1163-19-5 | Great Lakes Chemical DE-83Ôäó Decabromodiphenyl Oxide |
TBEP | 78-51-3 | Tris(2-butoxyethyl) phosphate |
TBP | 126-73-8 | Tri-n-butyl phosphate |
TBPAn | 632-79-1 | Tetrabromophthalic anhydride |
TCC | 101-20-2 | N-(4-chlorophenyl)-N’-(3,4-dichlorophenyl)urea |
TCDT-83 | 133513-17-4 | 2,3,7,8-Tetrachlorodibenzothiophene |
TCDT-85 | 134705-49-0 | 2,4,6,8-Tetrachlorodibenzothiophene |
TCEP | 115-96-8 | Tris(2-chloroethyl) phosphate |
tChlorD | 5103-74-2 | trans-Chlordane (gamma) |
TCPP | 13674-84-5 | Tris[(2R)-1-chloro-2-propyl] phosphate |
TCS | 3380-34-5 | 5-Chloro-2-(2,4-dichlorophenoxy)phenol |
TCS-M | 3380-34-5 | 5-Chloro-2-(2,4-dichlorophenoxy)phenol |
TDBPP | 126-72-7 | Tris(2,3-dibromopropyl) phosphate |
TDCPP | 13674-87-8 | Tris(1,3-dichloro-2-propyl) phosphate |
TDTFWD | M/C | Multi-Column Combined Window Defining/Resolution Mix |
TEHP | 78-42-2 | Tris(2-ethylhexyl) phosphate |
TEP | 78-40-0 | Tri-ethyl phosphate |
TFA | 76-05-1 | Trifluoroacetic acid |
tHBCD | 878049-07-1 | theta-1,2,5,6,9,10-Hexabromocyclododecane |
TMTP | 563-04-2 | Tri-m-tolyl phosphate |
tNChlor | 39765-80-5 | trans-Nonachlor |
TOTP | 78-30-8 | Tri-o-tolyl phosphate |
TPCB-CVS-A | M/C | CSL/CS1/CS2/CS3/CS4/CS5 |
TPCB-IS-A100 | M/C | Mass-Labelled PCB Recovery/Internal Standards |
TPCB-IS-A20 | M/C | Mass-Labelled PCB Recovery/Internal Standards |
TPCB-LCS-A100 | M/C | Mass-Labelled PCB Extractions Standard |
TPCB-LCS-A20 | M/C | Mass-Labelled PCB Extractions Standard |
TPCB-LCS-B100 | M/C | Mass-Labelled PCB Extractions Standard |
TPCB-LCS-B20 | M/C | Mass-Labelled PCB Extractions Standard |
TPCB-SS-A100 | M/C | Mass-Labelled PCB Sampling/Cleanup Standards |
TPCB-SS-A20 | M/C | Mass-Labelled PCB Sampling/Cleanup Standards |
TPP | 115-86-6 | Triphenyl phosphate |
TPrP | 513-08-6 | Tri-n-propyl phosphate |
TPTP | 78-32-0 | Tri-p-tolyl phosphate |
UV-328 | 25973-55-1 | 2-(2H-Benzotriazol-2-yl)-4,6-bis(1,1-dimethylpropyl)phenol |
WM48-CVS | M/C | Calibration Kit for WHO & Marker PCBs; EN 1948-4:2010 |
WMF-02 | N/A | Reference “Freeze-Dried" Fish Tissue (Naturally Fortified Salmon) |
WMF-03 | N/A | Reference “Freeze-Dried" Fish Tissue (Low Level Salmon) |
WMF-EX | N/A | Reference Fish Tissue Extract (Isooctane/20% Salmon Oil) |
WMS-01 | N/A | Reference Lake Sediment for Organic Contaminant Analysis |
WP-CVS | M/C | Dioxin-Like PCBs Calibration Kit |
WP-CVS-F | M/C | WHO/EPA PCB Calibration Kit |
WP-FS | M/C | Mass-Labelled WHO/EPA PCB Field Spiking Solution |
WP-ISS | M/C | Internal Standard Solution |
WP-LCS | M/C | Surrogate Spiking Solution |
WP-STK | M/C | Native PCB Solution |
XE-2367-S | 118516-13-5 | 2,3,6,7-Tetrachloroxanthene |
zHBCD | 878049-06-0 | zeta-1,2,5,6,9,10-Hexabromocyclododecane |